2-(5-chlorothiophen-2-yl)-N-(1-(4-(1-(dimethylamino)ethyl)-2-fluorophenyl)-2-oxopyrrolidin-3-yl)ethene-1-sulfonamide

ID: ALA5269594

Max Phase: Preclinical

Molecular Formula: C20H23ClFN3O3S2

Molecular Weight: 472.01

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(c1ccc(N2CCC(NS(=O)(=O)/C=C/c3ccc(Cl)s3)C2=O)c(F)c1)N(C)C

Standard InChI:  InChI=1S/C20H23ClFN3O3S2/c1-13(24(2)3)14-4-6-18(16(22)12-14)25-10-8-17(20(25)26)23-30(27,28)11-9-15-5-7-19(21)29-15/h4-7,9,11-13,17,23H,8,10H2,1-3H3/b11-9+

Standard InChI Key:  AFDHTIFDRFSZDA-PKNBQFBNSA-N

Molfile:  

 
     RDKit          2D

 30 32  0  0  0  0  0  0  0  0999 V2000
   -3.6490   -2.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8240   -2.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5865   -1.9691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8076   -1.6967    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1822   -2.2350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4032   -1.9626    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.2221   -2.5010    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0010   -2.2286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6793   -2.6986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3359   -2.1988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0635   -1.4382    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5335   -0.7416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3559   -0.8095    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8260   -0.1313    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4736    0.6148    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6512    0.6828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1812    0.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2384   -1.4382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7387   -0.7816    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2648   -1.4990    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9214   -1.9988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7118   -1.7614    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.3557    0.0045    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.8864    1.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4736    2.0445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.7118    1.3297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6482    2.0445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8864    2.7594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1814   -1.3778    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6160   -1.1650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  2  0
 17 12  2  0
 16 17  1  0
 18  8  1  0
 18 11  1  0
 18 19  2  0
 20  3  1  0
 21 20  1  0
  1 21  2  0
 21 22  1  0
 17 23  1  0
 15 24  1  0
 24 25  1  0
 24 26  1  0
 25 27  1  0
 25 28  1  0
  6 29  2  0
  6 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5269594

    ---

Associated Targets(Human)

F10 Tclin Coagulation factor X (9693 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 472.01Molecular Weight (Monoisotopic): 471.0853AlogP: 3.86#Rotatable Bonds: 7
Polar Surface Area: 69.72Molecular Species: BASEHBA: 5HBD: 1
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 8.22CX Basic pKa: 8.83CX LogP: 2.45CX LogD: 1.86
Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.67Np Likeness Score: -1.73

References

1. Patel NR, Patel DV, Murumkar PR, Yadav MR..  (2016)  Contemporary developments in the discovery of selective factor Xa inhibitors: A review.,  121  [PMID:27322757] [10.1016/j.ejmech.2016.05.039]

Source