The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
4-cyano-N-(4-(5,6,7-trimethoxy-4-oxo-4H-chromen-2-yl)phenyl)benzamide ID: ALA5269618
Max Phase: Preclinical
Molecular Formula: C26H20N2O6
Molecular Weight: 456.45
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc2oc(-c3ccc(NC(=O)c4ccc(C#N)cc4)cc3)cc(=O)c2c(OC)c1OC
Standard InChI: InChI=1S/C26H20N2O6/c1-31-22-13-21-23(25(33-3)24(22)32-2)19(29)12-20(34-21)16-8-10-18(11-9-16)28-26(30)17-6-4-15(14-27)5-7-17/h4-13H,1-3H3,(H,28,30)
Standard InChI Key: OYXNRGWJLJUPBB-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-4.2843 -0.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5697 0.0016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8577 -0.4102 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8577 -1.2354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5679 -1.6472 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2843 -1.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9989 -1.6517 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.7135 -1.2391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1400 -1.6495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4284 -1.2328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4302 -0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1450 0.0006 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7155 0.0007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7152 0.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0024 1.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7124 0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7139 0.0028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0021 -0.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4270 1.2365 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1416 0.8239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8563 1.2365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8565 2.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5693 2.4725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2842 2.0598 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2858 1.2387 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5739 0.8222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1416 -0.0011 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1400 -2.4747 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9989 0.0019 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.9989 0.8271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5679 -2.4723 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2824 -2.8849 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9989 2.4723 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7135 2.8849 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
6 7 1 0
7 8 1 0
4 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
3 12 1 0
13 11 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
18 17 2 0
13 18 1 0
16 19 1 0
19 20 1 0
20 21 1 0
22 21 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
21 26 1 0
20 27 2 0
9 28 2 0
1 29 1 0
29 30 1 0
5 31 1 0
31 32 1 0
33 24 1 0
33 34 3 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 456.45Molecular Weight (Monoisotopic): 456.1321AlogP: 4.61#Rotatable Bonds: 6Polar Surface Area: 110.79Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 3.44CX LogD: 3.44Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.45Np Likeness Score: -0.21
References 1. Hassan AHE, Lee KT, Lee YS.. (2020) Flavone-based arylamides as potential anticancers: Design, synthesis and in vitro cell-based/cell-free evaluations., 187 [PMID:31877541 ] [10.1016/j.ejmech.2019.111965 ]