The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Pinobanksin-3-acetate ID: ALA5269764
Max Phase: Preclinical
Molecular Formula: C17H14O6
Molecular Weight: 314.29
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)O[C@@H]1C(=O)c2c(O)cc(O)cc2O[C@H]1c1ccccc1
Standard InChI: InChI=1S/C17H14O6/c1-9(18)22-17-15(21)14-12(20)7-11(19)8-13(14)23-16(17)10-5-3-2-4-6-10/h2-8,16-17,19-20H,1H3/t16-,17+/m0/s1
Standard InChI Key: BJYHZSNSMVEQEH-DLBZAZTESA-N
Molfile:
RDKit 2D
23 25 0 0 0 0 0 0 0 0999 V2000
-2.1335 0.4114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1335 -0.4135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4202 -0.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7131 -0.4098 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7131 0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4220 0.8219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0015 0.8226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7101 0.4118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7101 -0.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0015 -0.8207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0015 -1.6424 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4217 -0.8207 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4217 -1.6424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1333 -2.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7101 -2.0533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.4217 0.8226 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1363 0.4099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8452 0.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8452 1.6423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1318 2.0533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4217 1.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4202 -1.6416 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8452 0.8222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 2 0
5 7 1 0
8 7 1 0
9 8 1 0
10 9 1 0
4 10 1 0
10 11 2 0
9 12 1 6
12 13 1 0
13 14 1 0
13 15 2 0
8 16 1 1
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 16 2 0
3 22 1 0
1 23 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 314.29Molecular Weight (Monoisotopic): 314.0790AlogP: 2.35#Rotatable Bonds: 2Polar Surface Area: 93.06Molecular Species: NEUTRALHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 7.75CX Basic pKa: ┄CX LogP: 2.86CX LogD: 2.71Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.83Np Likeness Score: 2.15
References 1. Phull MS, Jadav SS, Gundla R, Mainkar PS.. (2021) A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors., 212 [PMID:33445154 ] [10.1016/j.ejmech.2020.113149 ]