Pinobanksin-3-acetate

ID: ALA5269764

Max Phase: Preclinical

Molecular Formula: C17H14O6

Molecular Weight: 314.29

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)O[C@@H]1C(=O)c2c(O)cc(O)cc2O[C@H]1c1ccccc1

Standard InChI:  InChI=1S/C17H14O6/c1-9(18)22-17-15(21)14-12(20)7-11(19)8-13(14)23-16(17)10-5-3-2-4-6-10/h2-8,16-17,19-20H,1H3/t16-,17+/m0/s1

Standard InChI Key:  BJYHZSNSMVEQEH-DLBZAZTESA-N

Molfile:  

 
     RDKit          2D

 23 25  0  0  0  0  0  0  0  0999 V2000
   -2.1335    0.4114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1335   -0.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4202   -0.8199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7131   -0.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7131    0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4220    0.8219    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0015    0.8226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7101    0.4118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7101   -0.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0015   -0.8207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0015   -1.6424    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4217   -0.8207    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4217   -1.6424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1333   -2.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7101   -2.0533    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4217    0.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1363    0.4099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8452    0.8247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8452    1.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1318    2.0533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4217    1.6443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4202   -1.6416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8452    0.8222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  6  1  2  0
  5  7  1  0
  8  7  1  0
  9  8  1  0
 10  9  1  0
  4 10  1  0
 10 11  2  0
  9 12  1  6
 12 13  1  0
 13 14  1  0
 13 15  2  0
  8 16  1  1
 16 17  1  0
 17 18  2  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 16  2  0
  3 22  1  0
  1 23  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5269764

    ---

Associated Targets(Human)

SW480 (6023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 314.29Molecular Weight (Monoisotopic): 314.0790AlogP: 2.35#Rotatable Bonds: 2
Polar Surface Area: 93.06Molecular Species: NEUTRALHBA: 6HBD: 2
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 7.75CX Basic pKa: CX LogP: 2.86CX LogD: 2.71
Aromatic Rings: 2Heavy Atoms: 23QED Weighted: 0.83Np Likeness Score: 2.15

References

1. Phull MS, Jadav SS, Gundla R, Mainkar PS..  (2021)  A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors.,  212  [PMID:33445154] [10.1016/j.ejmech.2020.113149]

Source