(4-((2-chloro-N-(4-phenylthiazol-2-yl)benzamido)methyl)phenyl)sulfamic acid

ID: ALA5269779

Max Phase: Preclinical

Molecular Formula: C23H18ClN3O4S2

Molecular Weight: 500.00

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(c1ccccc1Cl)N(Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2ccccc2)cs1

Standard InChI:  InChI=1S/C23H18ClN3O4S2/c24-20-9-5-4-8-19(20)22(28)27(14-16-10-12-18(13-11-16)26-33(29,30)31)23-25-21(15-32-23)17-6-2-1-3-7-17/h1-13,15,26H,14H2,(H,29,30,31)

Standard InChI Key:  GPWLOXDZGKEYRS-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    1.8479    1.9301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1297    1.5241    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4190    1.9429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2991    1.5368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3065    0.7118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0247    0.3057    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7354    0.7246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4536    0.3185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1644    0.7373    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1570    1.5623    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7281    1.5496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0099    1.9557    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1224    0.6990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8552    2.7551    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9897    0.7373    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3780   -0.0597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5626    1.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8333    0.2801    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.6405   -0.5397    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8383   -0.6135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5129    0.1494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4257   -1.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2775    1.9300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9897    1.5179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9897    0.6924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2793    0.2804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5626    0.6887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2775    2.7552    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.8381   -2.0431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4261   -2.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3993   -2.7552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8113   -2.0448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4030   -1.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  7  6  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
  7 11  2  0
 11 12  1  0
 12  4  2  0
 13  2  1  0
  1 14  2  0
  9 15  2  0
  9 16  2  0
  1 17  1  0
 18 13  1  0
 18 19  1  0
 19 20  2  0
 21 20  1  0
 13 21  2  0
 20 22  1  0
 23 17  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 17 27  1  0
 23 28  1  0
 29 22  2  0
 30 29  1  0
 31 30  2  0
 32 31  1  0
 33 32  2  0
 22 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5269779

    ---

Associated Targets(Human)

PTPRB Tchem Receptor-type tyrosine-protein phosphatase beta (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 500.00Molecular Weight (Monoisotopic): 499.0427AlogP: 5.53#Rotatable Bonds: 7
Polar Surface Area: 99.60Molecular Species: ACIDHBA: 5HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: -1.76CX Basic pKa: CX LogP: 3.58CX LogD: 2.75
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -1.81

References

1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S..  (2020)  Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors.,  28  (23.0): [PMID:32992253] [10.1016/j.bmc.2020.115777]

Source