The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-((2-chloro-N-(4-phenylthiazol-2-yl)benzamido)methyl)phenyl)sulfamic acid ID: ALA5269779
Max Phase: Preclinical
Molecular Formula: C23H18ClN3O4S2
Molecular Weight: 500.00
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccccc1Cl)N(Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2ccccc2)cs1
Standard InChI: InChI=1S/C23H18ClN3O4S2/c24-20-9-5-4-8-19(20)22(28)27(14-16-10-12-18(13-11-16)26-33(29,30)31)23-25-21(15-32-23)17-6-2-1-3-7-17/h1-13,15,26H,14H2,(H,29,30,31)
Standard InChI Key: GPWLOXDZGKEYRS-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
1.8479 1.9301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1297 1.5241 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4190 1.9429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2991 1.5368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3065 0.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0247 0.3057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7354 0.7246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4536 0.3185 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1644 0.7373 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.1570 1.5623 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7281 1.5496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0099 1.9557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1224 0.6990 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8552 2.7551 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.9897 0.7373 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3780 -0.0597 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5626 1.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8333 0.2801 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.6405 -0.5397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8383 -0.6135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5129 0.1494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4257 -1.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2775 1.9300 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9897 1.5179 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9897 0.6924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2793 0.2804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5626 0.6887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2775 2.7552 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.8381 -2.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4261 -2.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3993 -2.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8113 -2.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4030 -1.3282 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
7 6 1 0
7 8 1 0
9 8 1 0
9 10 1 0
7 11 2 0
11 12 1 0
12 4 2 0
13 2 1 0
1 14 2 0
9 15 2 0
9 16 2 0
1 17 1 0
18 13 1 0
18 19 1 0
19 20 2 0
21 20 1 0
13 21 2 0
20 22 1 0
23 17 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
17 27 1 0
23 28 1 0
29 22 2 0
30 29 1 0
31 30 2 0
32 31 1 0
33 32 2 0
22 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 500.00Molecular Weight (Monoisotopic): 499.0427AlogP: 5.53#Rotatable Bonds: 7Polar Surface Area: 99.60Molecular Species: ACIDHBA: 5HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: -1.76CX Basic pKa: ┄CX LogP: 3.58CX LogD: 2.75Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -1.81
References 1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S.. (2020) Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors., 28 (23.0): [PMID:32992253 ] [10.1016/j.bmc.2020.115777 ]