The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-hydroxyethyl)-6-morpholino-5-nitro-1H-benzo[de]isoquinoline-1,3(2H)-dione ID: ALA5269853
Max Phase: Preclinical
Molecular Formula: C18H17N3O6
Molecular Weight: 371.35
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2cccc3c(N4CCOCC4)c([N+](=O)[O-])cc(c23)C(=O)N1CCO
Standard InChI: InChI=1S/C18H17N3O6/c22-7-4-20-17(23)12-3-1-2-11-15(12)13(18(20)24)10-14(21(25)26)16(11)19-5-8-27-9-6-19/h1-3,10,22H,4-9H2
Standard InChI Key: JNECHXNVCQPXNY-UHFFFAOYSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
-0.7114 -0.8259 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7127 -0.0009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0008 0.4109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -0.0002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7176 -0.8210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0068 -1.2388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4331 -1.2303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1395 -0.8131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1346 0.0034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4218 0.4111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4268 1.2388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7114 1.6500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0024 1.2361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7178 1.6474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7099 2.4752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1406 1.6527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4253 -1.2398 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1406 -0.8286 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4238 -2.0650 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0068 -2.0639 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7213 -2.4765 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7213 -3.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0067 -3.7143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7078 -3.3017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7078 -2.4766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4237 2.8891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4222 3.7143 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
4 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
3 13 1 0
13 14 2 0
12 15 1 0
11 16 2 0
17 1 1 0
17 18 1 0
17 19 2 0
20 6 1 0
20 21 1 0
22 21 1 0
23 22 1 0
24 23 1 0
20 25 1 0
25 24 1 0
15 26 1 0
26 27 1 0
M CHG 2 17 1 18 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 371.35Molecular Weight (Monoisotopic): 371.1117AlogP: 1.17#Rotatable Bonds: 4Polar Surface Area: 113.22Molecular Species: NEUTRALHBA: 7HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 1.05CX LogD: 1.05Aromatic Rings: 2Heavy Atoms: 27QED Weighted: 0.49Np Likeness Score: -1.13
References 1. Chen XM, Zhou JY, Liu SQ, Song LH, Wang HL, Wang Q, Liang SM, Lu L, Wei JH, Huang R, Zhang Y.. (2023) Design, synthesis, and antitumor evaluation of morpholine substituted bisnaphthalimides as DNA targeting agents., 85 [PMID:36894107 ] [10.1016/j.bmcl.2023.129218 ]