22-O-methylmycotrienin II

ID: ALA5269967

Max Phase: Preclinical

Molecular Formula: C37H52N2O8

Molecular Weight: 652.83

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc2c(O)c(c1)NC(=O)C[C@@H](OC)/C=C/C=C/C=C/C[C@H](OC(=O)[C@@H](C)NC(=O)C1CCCCC1)[C@H](C)[C@@H](O)/C(C)=C\CC2

Standard InChI:  InChI=1S/C37H52N2O8/c1-24-15-14-18-28-21-30(46-5)22-31(35(28)42)39-33(40)23-29(45-4)19-12-7-6-8-13-20-32(25(2)34(24)41)47-37(44)26(3)38-36(43)27-16-10-9-11-17-27/h6-8,12-13,15,19,21-22,25-27,29,32,34,41-42H,9-11,14,16-18,20,23H2,1-5H3,(H,38,43)(H,39,40)/b7-6+,13-8+,19-12+,24-15-/t25-,26+,29-,32-,34-/m0/s1

Standard InChI Key:  PEANSLAKPSVOFU-GXNSDRJYSA-N

Molfile:  

 
     RDKit          2D

 47 49  0  0  0  0  0  0  0  0999 V2000
    1.7894    2.0630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5040    2.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2160    2.0633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2160    1.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5057    0.8263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7894    1.2345    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0747    0.8218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3572    0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0719    1.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7865    0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7865    0.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0719   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0719   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3572   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0719   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7866   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5014   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2160   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9306   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6454   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6454   -0.4121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9306    0.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9306    0.8255    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2160   -0.4121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3600   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0746   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3572    0.0004    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5012   -0.4121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5012    1.2382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5040    3.3005    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7865   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7865   -2.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5012   -2.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0719   -2.8879    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5012   -3.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2158   -2.4753    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9306   -2.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6453   -2.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9306   -3.7131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3600   -2.8879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0746   -2.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0746   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3600   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6453   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7892    3.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5057    0.0011    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  1  6  2  0
  6  5  1  0
  6  7  1  0
  7  8  1  0
  9  8  1  0
 10  9  2  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 14 13  1  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 20 19  2  0
 21 20  1  0
 22 21  1  0
 23 22  1  0
  4 24  1  0
 24 23  1  0
 23 25  2  0
 21 26  1  1
 26 27  1  0
 12 28  1  1
 11 29  1  1
 10 30  1  0
  2 31  1  0
 13 32  1  6
 32 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  1
 34 37  1  0
 37 38  1  0
 38 39  1  0
 38 40  2  0
 41 39  1  0
 42 41  1  0
 43 42  1  0
 44 43  1  0
 45 44  1  0
 39 45  1  0
 31 46  1  0
  5 47  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5269967

    ---

Associated Targets(non-human)

L5178Y (1809 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 652.83Molecular Weight (Monoisotopic): 652.3724AlogP: 5.69#Rotatable Bonds: 6
Polar Surface Area: 143.42Molecular Species: NEUTRALHBA: 8HBD: 4
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.50CX Basic pKa: CX LogP: 5.45CX LogD: 5.45
Aromatic Rings: 1Heavy Atoms: 47QED Weighted: 0.17Np Likeness Score: 0.95

References

1. Yang X, Wu W, Li H, Zhang M, Chu Z, Wang X, Sun P..  (2022)  Natural occurrence, bioactivity, and biosynthesis of triene-ansamycins.,  244  [PMID:36240545] [10.1016/j.ejmech.2022.114815]

Source