The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-[3-({[2-(5,7-difluoro-1H-1,3-benzodiazol-2-yl)pyrimidin-5-yl]amino}methyl)pyridin-2-yl]-N-methylmethanesulfonamide ID: ALA5270173
Max Phase: Preclinical
Molecular Formula: C19H17F2N7O2S
Molecular Weight: 445.46
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(c1ncccc1CNc1cnc(-c2nc3cc(F)cc(F)c3[nH]2)nc1)S(C)(=O)=O
Standard InChI: InChI=1S/C19H17F2N7O2S/c1-28(31(2,29)30)19-11(4-3-5-22-19)8-23-13-9-24-17(25-10-13)18-26-15-7-12(20)6-14(21)16(15)27-18/h3-7,9-10,23H,8H2,1-2H3,(H,26,27)
Standard InChI Key: YWRJBQKYFMGYJH-UHFFFAOYSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
-4.0857 0.0463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3711 0.4586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6592 0.0467 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6592 -0.7784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3693 -1.1902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0857 -0.7821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8550 0.2969 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3842 -0.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8763 -1.0243 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5591 -0.3567 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1463 -1.0713 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6763 -1.0705 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0891 -0.3557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6799 0.3561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1447 0.3609 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9143 -0.3557 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3268 -1.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1521 -1.0703 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5649 -0.3557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3876 -0.3565 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.8004 -1.0714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3911 -1.7832 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5665 -1.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1523 0.3587 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.3271 0.3587 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5649 1.0734 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.1523 1.7881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1484 1.6569 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2795 0.6608 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3711 1.2838 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.8004 -1.1947 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
7 8 1 0
9 8 2 0
4 9 1 0
8 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
13 16 1 0
16 17 1 0
17 18 1 0
19 18 2 0
20 19 1 0
21 20 2 0
22 21 1 0
23 22 2 0
18 23 1 0
19 24 1 0
24 25 1 0
24 26 1 0
26 27 1 0
26 28 2 0
26 29 2 0
2 30 1 0
6 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.46Molecular Weight (Monoisotopic): 445.1133AlogP: 2.70#Rotatable Bonds: 6Polar Surface Area: 116.76Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 8.00CX Basic pKa: 0.23CX LogP: 1.89CX LogD: 1.81Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.47Np Likeness Score: -1.77