The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5270179
Max Phase: Preclinical
Molecular Formula: C28H35N3O2
Molecular Weight: 445.61
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)=CCN1CCN(c2ccc3c(c2)[C@H]2C[C@@H]3CCN2C(=O)OCc2ccccc2)CC1
Standard InChI: InChI=1S/C28H35N3O2/c1-21(2)10-12-29-14-16-30(17-15-29)24-8-9-25-23-11-13-31(27(18-23)26(25)19-24)28(32)33-20-22-6-4-3-5-7-22/h3-10,19,23,27H,11-18,20H2,1-2H3/t23-,27+/m0/s1
Standard InChI Key: HPMFKLUVLCAJPU-WNCULLNHSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
-1.1932 -0.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4786 -0.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4768 -1.7907 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1932 -1.3826 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2286 -1.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2332 -1.3789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2332 -0.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9914 -0.4034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3596 0.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0718 -0.5703 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5487 -0.9421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1833 -1.4980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9078 -0.1416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6224 -0.5541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3370 -0.1416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3370 0.6836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6224 1.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9078 0.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0517 1.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5788 0.3111 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.2286 -1.9214 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.4843 0.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0718 0.8588 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3096 0.1441 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7221 0.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5474 0.8588 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9602 1.5734 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7829 1.5726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1956 0.8578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7864 0.1459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9617 0.1411 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7662 0.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4809 1.0961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.1956 0.6836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4809 1.9214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 4 1 0
4 3 2 0
5 6 1 0
6 3 1 0
6 7 2 0
7 2 1 0
7 8 1 0
5 9 1 0
8 9 1 0
8 10 1 0
10 11 1 0
5 12 1 0
12 11 1 0
1 13 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
18 17 1 0
13 18 1 0
16 19 1 0
8 20 1 6
5 21 1 1
10 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
19 32 1 0
32 33 2 0
33 34 1 0
33 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 445.61Molecular Weight (Monoisotopic): 445.2729AlogP: 5.35#Rotatable Bonds: 5Polar Surface Area: 36.02Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 7.87CX LogP: 5.16CX LogD: 4.56Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.58Np Likeness Score: -0.16
References 1. Turnaturi R, Montenegro L, Marrazzo A, Parenti R, Pasquinucci L, Parenti C.. (2018) Benzomorphan skeleton, a versatile scaffold for different targets: A comprehensive review., 155 [PMID:29908442 ] [10.1016/j.ejmech.2018.06.017 ]