ID: ALA5270179

Max Phase: Preclinical

Molecular Formula: C28H35N3O2

Molecular Weight: 445.61

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)=CCN1CCN(c2ccc3c(c2)[C@H]2C[C@@H]3CCN2C(=O)OCc2ccccc2)CC1

Standard InChI:  InChI=1S/C28H35N3O2/c1-21(2)10-12-29-14-16-30(17-15-29)24-8-9-25-23-11-13-31(27(18-23)26(25)19-24)28(32)33-20-22-6-4-3-5-7-22/h3-10,19,23,27H,11-18,20H2,1-2H3/t23-,27+/m0/s1

Standard InChI Key:  HPMFKLUVLCAJPU-WNCULLNHSA-N

Molfile:  

 
     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
   -1.1932   -0.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4786   -0.1418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4768   -1.7907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1932   -1.3826    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2286   -1.0961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2332   -1.3789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2332   -0.5537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9914   -0.4034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3596    0.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0718   -0.5703    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5487   -0.9421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1833   -1.4980    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9078   -0.1416    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6224   -0.5541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3370   -0.1416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3370    0.6836    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6224    1.0961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9078    0.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0517    1.0961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5788    0.3111    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2286   -1.9214    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4843    0.1441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0718    0.8588    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3096    0.1441    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7221    0.8588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5474    0.8588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9602    1.5734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7829    1.5726    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1956    0.8578    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7864    0.1459    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9617    0.1411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7662    0.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4809    1.0961    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1956    0.6836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4809    1.9214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  1  4  1  0
  4  3  2  0
  5  6  1  0
  6  3  1  0
  6  7  2  0
  7  2  1  0
  7  8  1  0
  5  9  1  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
  5 12  1  0
 12 11  1  0
  1 13  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 13 18  1  0
 16 19  1  0
  8 20  1  6
  5 21  1  1
 10 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 19 32  1  0
 32 33  2  0
 33 34  1  0
 33 35  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5270179

    ---

Associated Targets(Human)

TMEM97 Tchem Sigma intracellular receptor 2 (973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 445.61Molecular Weight (Monoisotopic): 445.2729AlogP: 5.35#Rotatable Bonds: 5
Polar Surface Area: 36.02Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.87CX LogP: 5.16CX LogD: 4.56
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.58Np Likeness Score: -0.16

References

1. Turnaturi R, Montenegro L, Marrazzo A, Parenti R, Pasquinucci L, Parenti C..  (2018)  Benzomorphan skeleton, a versatile scaffold for different targets: A comprehensive review.,  155  [PMID:29908442] [10.1016/j.ejmech.2018.06.017]

Source