(1Z,4Z)-N1-((Z)-1-(((Z)-1-((2-aminoethyl)imino)-1-hydroxypropan-2-yl)imino)-1-hydroxy-3,3-dimethylbutan-2-yl)-N4-hydroxy-2-isobutylsuccinimidic acid

ID: ALA5270233

Max Phase: Preclinical

Molecular Formula: C19H37N5O5

Molecular Weight: 415.54

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CC(C)CC(CC(=O)NO)C(=O)NC(C(=O)NC(C)C(=O)NCCN)C(C)(C)C

Standard InChI:  InChI=1S/C19H37N5O5/c1-11(2)9-13(10-14(25)24-29)17(27)23-15(19(4,5)6)18(28)22-12(3)16(26)21-8-7-20/h11-13,15,29H,7-10,20H2,1-6H3,(H,21,26)(H,22,28)(H,23,27)(H,24,25)

Standard InChI Key:  LMIQCBIEAHJAMZ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 29 28  0  0  0  0  0  0  0  0999 V2000
   -1.7866   -1.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7866   -2.4756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5012   -1.2378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0719   -1.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3573   -1.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573   -1.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3573   -2.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0719   -1.6504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573   -2.8882    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7866   -1.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573   -3.7134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0719   -2.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7866   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5012   -1.6504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5012    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0719    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2159   -1.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5012   -2.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2159   -2.0629    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0719    0.8251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573    1.2378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7864    1.2376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3573    0.8251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573    2.0629    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3573    2.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3573    3.3008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0719    3.7134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2159   -1.6504    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  1  3  1  0
  4  1  1  0
  5  4  1  0
  6  5  1  0
  5  7  1  0
  6  8  2  0
  6  9  1  0
  7 10  1  0
 11  9  1  0
 10 12  1  0
 10 13  1  0
 14 11  1  0
 11 15  1  0
 14 16  2  0
 14 17  1  0
 15 18  1  0
 15 19  1  0
 15 20  1  0
 21 17  1  0
 21 22  1  0
 21 23  1  0
 22 24  2  0
 22 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
  3 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5270233

    ---

Associated Targets(Human)

ACE2 Tchem Angiotensin-converting enzyme 2 (190 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 415.54Molecular Weight (Monoisotopic): 415.2795AlogP: -0.35#Rotatable Bonds: 11
Polar Surface Area: 162.65Molecular Species: BASEHBA: 6HBD: 6
#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 7#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.71CX Basic pKa: 9.35CX LogP: -1.35CX LogD: -2.37
Aromatic Rings: Heavy Atoms: 29QED Weighted: 0.20Np Likeness Score: 0.40

References

1. Xiu S, Dick A, Ju H, Mirzaie S, Abdi F, Cocklin S, Zhan P, Liu X..  (2020)  Inhibitors of SARS-CoV-2 Entry: Current and Future Opportunities.,  63  (21.0): [PMID:32539378] [10.1021/acs.jmedchem.0c00502]

Source