The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(5-(1H-imidazol-1-yl)-3-methyl-1-phenyl-1H-pyrazol-4-yl)-7-amino-2,4-dioxo-2,3,4,5-tetrahydro-1H-pyrano[2,3-d]pyrimidine-6-carbonitrile ID: ALA5270268
Max Phase: Preclinical
Molecular Formula: C21H16N8O3
Molecular Weight: 428.41
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1nn(-c2ccccc2)c(-n2ccnc2)c1C1C(C#N)=C(N)Oc2[nH]c(=O)[nH]c(=O)c21
Standard InChI: InChI=1S/C21H16N8O3/c1-11-14(15-13(9-22)17(23)32-19-16(15)18(30)25-21(31)26-19)20(28-8-7-24-10-28)29(27-11)12-5-3-2-4-6-12/h2-8,10,15H,23H2,1H3,(H2,25,26,30,31)
Standard InChI Key: MSMOXPRRTALCEH-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 36 0 0 0 0 0 0 0 0999 V2000
2.5011 -3.2097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7866 -2.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0719 -3.2097 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -2.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 -3.2097 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0721 -2.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7866 -3.2096 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0721 -1.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 -1.5592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3574 -0.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3100 0.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1069 0.0704 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4024 -0.6562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2259 -0.6562 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4394 0.1402 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7477 0.5893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0551 1.0687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4675 1.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2961 1.7831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7042 2.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2924 3.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4671 3.2097 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0552 2.4978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7700 1.0687 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0249 0.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8218 0.0704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3572 -1.9719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0719 -1.5592 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0719 -0.7342 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7866 -1.9719 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7866 -1.5593 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5011 -1.1468 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 1 0
5 4 1 0
6 5 1 0
6 7 1 0
8 6 2 0
8 9 1 0
9 10 1 0
11 10 2 0
12 11 1 0
13 12 1 0
14 13 2 0
15 14 1 0
16 15 2 0
12 16 1 0
17 11 1 0
18 17 1 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 18 2 0
24 17 1 0
25 24 2 0
25 10 1 0
25 26 1 0
27 9 1 0
4 27 2 0
27 28 1 0
28 29 2 0
30 28 1 0
2 30 1 0
31 8 1 0
31 32 3 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.41Molecular Weight (Monoisotopic): 428.1345AlogP: 0.96#Rotatable Bonds: 3Polar Surface Area: 160.40Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 8.38CX Basic pKa: 5.86CX LogP: 0.56CX LogD: 0.51Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -1.83
References 1. Elattar KM, El-Khateeb AY, Hamed SE.. (2022) Insights into the recent progress in the medicinal chemistry of pyranopyrimidine analogs., 13 (5.0): [PMID:35694689 ] [10.1039/d2md00076h ]