(4-((2-(3-fluorophenyl)-N-(4-(thiophen-2-yl)thiazol-2-yl)acetamido)methyl)phenyl)sulfamic acid

ID: ALA5270367

Max Phase: Preclinical

Molecular Formula: C22H18FN3O4S3

Molecular Weight: 503.60

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Cc1cccc(F)c1)N(Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2cccs2)cs1

Standard InChI:  InChI=1S/C22H18FN3O4S3/c23-17-4-1-3-16(11-17)12-21(27)26(22-24-19(14-32-22)20-5-2-10-31-20)13-15-6-8-18(9-7-15)25-33(28,29)30/h1-11,14,25H,12-13H2,(H,28,29,30)

Standard InChI Key:  FNMBJKNBXKIEML-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    1.1319    1.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4137    1.2718    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2970    1.6907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0152    1.2845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0225    0.4596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7407    0.0535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4515    0.4724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1696    0.0662    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8804    0.4851    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8730    1.3101    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4441    1.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7259    1.7034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4063    0.4468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1392    2.5029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7057    0.4851    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0940   -0.3120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8466    1.2653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1173    0.0278    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    0.9246   -0.7920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1223   -0.8657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2030   -0.1028    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2903   -1.5804    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5613    1.6779    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1223   -2.2951    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4490   -2.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1836   -2.5832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0913   -1.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5615    2.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2745    2.9139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9893    2.5012    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9909    1.6800    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2791    1.2634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7057    1.2674    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  7  6  1  0
  7  8  1  0
  9  8  1  0
  9 10  1  0
  7 11  2  0
 11 12  1  0
 12  4  2  0
 13  2  1  0
  1 14  2  0
  9 15  2  0
  9 16  2  0
  1 17  1  0
 18 13  1  0
 18 19  1  0
 19 20  2  0
 21 20  1  0
 13 21  2  0
 20 22  1  0
 23 17  1  0
 24 22  1  0
 24 25  1  0
 25 26  2  0
 27 26  1  0
 22 27  2  0
 28 23  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 23 32  1  0
 31 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5270367

    ---

Associated Targets(Human)

PTPRB Tchem Receptor-type tyrosine-protein phosphatase beta (330 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 503.60Molecular Weight (Monoisotopic): 503.0443AlogP: 5.00#Rotatable Bonds: 8
Polar Surface Area: 99.60Molecular Species: ACIDHBA: 6HBD: 2
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2
CX Acidic pKa: -1.86CX Basic pKa: CX LogP: 2.88CX LogD: 2.05
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.33Np Likeness Score: -2.14

References

1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S..  (2020)  Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors.,  28  (23.0): [PMID:32992253] [10.1016/j.bmc.2020.115777]

Source