ID: ALA5270567

Max Phase: Preclinical

Molecular Formula: C26H31N3O2

Molecular Weight: 417.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=CCN1CCN(c2ccc3c(c2)[C@H]2C[C@@H]3CCN2C(=O)OCc2ccccc2)CC1

Standard InChI:  InChI=1S/C26H31N3O2/c1-2-11-27-13-15-28(16-14-27)22-8-9-23-21-10-12-29(25(17-21)24(23)18-22)26(30)31-19-20-6-4-3-5-7-20/h2-9,18,21,25H,1,10-17,19H2/t21-,25+/m0/s1

Standard InChI Key:  GSYHQGDRZFDPGP-SQJMNOBHSA-N

Molfile:  

 
     RDKit          2D

 33 37  0  0  0  0  0  0  0  0999 V2000
   -1.5505   -0.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8359    0.0320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8341   -1.6166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5505   -1.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8714   -0.9222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1241   -1.2050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1241   -0.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6341   -0.2294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0024    0.5497    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7144   -0.3963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1913   -0.7681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8261   -1.3240    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2652    0.0323    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9798   -0.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6944    0.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6944    0.8575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9798    1.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2652    0.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4090    1.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2215    0.4851    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8714   -1.7474    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1269    0.3182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7144    1.0328    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9522    0.3182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3648    1.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1900    1.0328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6028    1.7474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4255    1.7466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8383    1.0317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4291    0.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6044    0.3151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1237    0.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8383    1.2701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  1  4  1  0
  4  3  2  0
  5  6  1  0
  6  3  1  0
  6  7  2  0
  7  2  1  0
  7  8  1  0
  5  9  1  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
  5 12  1  0
 12 11  1  0
  1 13  1  0
 14 13  1  0
 15 14  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 13 18  1  0
 16 19  1  0
  8 20  1  6
  5 21  1  1
 10 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  1  0
 27 26  2  0
 28 27  1  0
 29 28  2  0
 30 29  1  0
 31 30  2  0
 26 31  1  0
 19 32  1  0
 32 33  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5270567

    ---

Associated Targets(Human)

TMEM97 Tchem Sigma intracellular receptor 2 (973 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 417.55Molecular Weight (Monoisotopic): 417.2416AlogP: 4.57#Rotatable Bonds: 5
Polar Surface Area: 36.02Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.55CX LogP: 4.53CX LogD: 4.15
Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.67Np Likeness Score: -0.46

References

1. Turnaturi R, Montenegro L, Marrazzo A, Parenti R, Pasquinucci L, Parenti C..  (2018)  Benzomorphan skeleton, a versatile scaffold for different targets: A comprehensive review.,  155  [PMID:29908442] [10.1016/j.ejmech.2018.06.017]

Source