The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5270567
Max Phase: Preclinical
Molecular Formula: C26H31N3O2
Molecular Weight: 417.55
Associated Items:
Names and Identifiers Canonical SMILES: C=CCN1CCN(c2ccc3c(c2)[C@H]2C[C@@H]3CCN2C(=O)OCc2ccccc2)CC1
Standard InChI: InChI=1S/C26H31N3O2/c1-2-11-27-13-15-28(16-14-27)22-8-9-23-21-10-12-29(25(17-21)24(23)18-22)26(30)31-19-20-6-4-3-5-7-20/h2-9,18,21,25H,1,10-17,19H2/t21-,25+/m0/s1
Standard InChI Key: GSYHQGDRZFDPGP-SQJMNOBHSA-N
Molfile:
RDKit 2D
33 37 0 0 0 0 0 0 0 0999 V2000
-1.5505 -0.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8359 0.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8341 -1.6166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5505 -1.2087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8714 -0.9222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1241 -1.2050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1241 -0.3797 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6341 -0.2294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0024 0.5497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7144 -0.3963 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1913 -0.7681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8261 -1.3240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2652 0.0323 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9798 -0.3802 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6944 0.0323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6944 0.8575 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.9798 1.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2652 0.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4090 1.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2215 0.4851 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.8714 -1.7474 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1269 0.3182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7144 1.0328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9522 0.3182 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.3648 1.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1900 1.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6028 1.7474 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4255 1.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8383 1.0317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4291 0.3199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6044 0.3151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1237 0.8575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.8383 1.2701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
1 4 1 0
4 3 2 0
5 6 1 0
6 3 1 0
6 7 2 0
7 2 1 0
7 8 1 0
5 9 1 0
8 9 1 0
8 10 1 0
10 11 1 0
5 12 1 0
12 11 1 0
1 13 1 0
14 13 1 0
15 14 1 0
16 15 1 0
17 16 1 0
18 17 1 0
13 18 1 0
16 19 1 0
8 20 1 6
5 21 1 1
10 22 1 0
22 23 2 0
22 24 1 0
24 25 1 0
25 26 1 0
27 26 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
26 31 1 0
19 32 1 0
32 33 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 417.55Molecular Weight (Monoisotopic): 417.2416AlogP: 4.57#Rotatable Bonds: 5Polar Surface Area: 36.02Molecular Species: NEUTRALHBA: 4HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 7.55CX LogP: 4.53CX LogD: 4.15Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.67Np Likeness Score: -0.46
References 1. Turnaturi R, Montenegro L, Marrazzo A, Parenti R, Pasquinucci L, Parenti C.. (2018) Benzomorphan skeleton, a versatile scaffold for different targets: A comprehensive review., 155 [PMID:29908442 ] [10.1016/j.ejmech.2018.06.017 ]