rac-6-{3-[(3-aminopyrrolidin-1-yl)methyl]phenyl}isoquinolin-1-ol

ID: ALA5270570

Max Phase: Preclinical

Molecular Formula: C20H21N3O

Molecular Weight: 319.41

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  NC1CCN(Cc2cccc(-c3ccc4c(O)nccc4c3)c2)C1

Standard InChI:  InChI=1S/C20H21N3O/c21-18-7-9-23(13-18)12-14-2-1-3-15(10-14)16-4-5-19-17(11-16)6-8-22-20(19)24/h1-6,8,10-11,18H,7,9,12-13,21H2,(H,22,24)

Standard InChI Key:  KJCKVXKGXLPESD-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   -4.2638    0.2072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5492    0.6195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8373    0.2076    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8373   -0.6175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5474   -1.0293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2638   -0.6212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1246    0.6183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4097    0.2060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4097   -0.6149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1195   -1.0316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6951    0.6186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6951    1.4438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0179    1.8545    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7342    1.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7342    0.6207    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0225    0.2042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4490    0.2081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1637    0.6207    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1637    1.4458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9678    1.6960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4385    1.0424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9466    0.3748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2638    1.0424    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5474   -1.8545    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  3  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  4 10  1  0
 11  8  1  0
 12 11  2  0
 13 12  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 11 16  1  0
 15 17  1  0
 17 18  1  0
 19 18  1  0
 19 20  1  0
 20 21  1  0
 22 21  1  0
 18 22  1  0
 21 23  1  0
  5 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5270570

    ---

Associated Targets(Human)

PRKACB Tchem cAMP-dependent protein kinase (PKA) (929 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 319.41Molecular Weight (Monoisotopic): 319.1685AlogP: 3.14#Rotatable Bonds: 3
Polar Surface Area: 62.38Molecular Species: BASEHBA: 4HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 11.84CX Basic pKa: 9.63CX LogP: 2.78CX LogD: 0.56
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.78Np Likeness Score: -0.70

References

1. Müller J, Klein R, Tarkhanova O, Gryniukova A, Borysko P, Merkl S, Ruf M, Neumann A, Gastreich M, Moroz YS, Klebe G, Glinca S..  (2022)  Magnet for the Needle in Haystack: "Crystal Structure First" Fragment Hits Unlock Active Chemical Matter Using Targeted Exploration of Vast Chemical Spaces.,  65  (23.0): [PMID:36069712] [10.1021/acs.jmedchem.2c00813]

Source