17-bromo-30-methyloscillatoxin D

ID: ALA5270633

Max Phase: Preclinical

Molecular Formula: C31H41BrO8

Molecular Weight: 621.57

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CO[C@@H](CC[C@H](C)[C@@H]1CC=C[C@]2(O1)[C@H](C(=O)O[C@@H]1CC(=O)O[C@@H]1C)C(=O)[C@H](C)CC2(C)C)c1cc(O)ccc1Br

Standard InChI:  InChI=1S/C31H41BrO8/c1-17(9-12-24(37-6)21-14-20(33)10-11-22(21)32)23-8-7-13-31(40-23)27(28(35)18(2)16-30(31,4)5)29(36)39-25-15-26(34)38-19(25)3/h7,10-11,13-14,17-19,23-25,27,33H,8-9,12,15-16H2,1-6H3/t17-,18+,19+,23-,24-,25+,27-,31-/m0/s1

Standard InChI Key:  RBPKLGLYYMZQSP-QPFOVLACSA-N

Molfile:  

 
     RDKit          2D

 41 44  0  0  0  0  0  0  0  0999 V2000
   -1.8462    1.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8462    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1318    0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4174    1.0303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4174    1.8553    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1318    2.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1318    3.0925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1668    0.4460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3794    1.2428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4176    0.2054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4176   -0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1318   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8460   -0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8460    0.2054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2965   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0108   -0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7250   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4393   -0.6192    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1535   -1.0315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8679   -0.6193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5796   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5796   -1.8561    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8697   -2.2678    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1535   -1.8598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8697   -3.0925    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8679    0.2053    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    2.4393    0.2054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7250    0.6178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2965   -1.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1655   -0.0360    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5605    0.6179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5605   -0.2067    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2747   -0.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3609   -1.4389    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1673   -1.6103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5794   -0.8964    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0278   -0.2838    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2413    0.5128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5796   -2.3245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2747    1.0303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5605    2.2677    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  1  6  1  0
  6  7  1  6
  4  8  1  0
  4  9  1  0
  3 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
 14 13  2  0
  3 14  1  6
 11 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 23 25  1  0
 20 26  1  0
 18 27  1  6
 27 28  1  0
 15 29  1  6
 11 30  1  1
  2 31  1  6
 31 32  1  0
 33 32  1  6
 34 33  1  0
 34 35  1  0
 35 36  1  0
 36 37  1  0
 37 33  1  0
 37 38  1  6
 35 39  2  0
 31 40  2  0
  1 41  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5270633

    ---

Associated Targets(non-human)

Nitzschia amabilis (14 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 621.57Molecular Weight (Monoisotopic): 620.1985AlogP: 5.84#Rotatable Bonds: 8
Polar Surface Area: 108.36Molecular Species: NEUTRALHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 8.92CX Basic pKa: CX LogP: 6.45CX LogD: 6.44
Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.22Np Likeness Score: 1.67

References

1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L..  (2020)  Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species.,  201  [PMID:32652435] [10.1016/j.ejmech.2020.112473]

Source