The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,4-Dideoxy-1,4-[(R)-(5-deoxy-1,3-O-[p-(trifluoromethyl)phenylmethylene)-D-arabinito1-5-yl]episulfoniumylidene]-D-arabinitol Chloride ID: ALA5270662
Max Phase: Preclinical
Molecular Formula: C18H24ClF3O7S
Molecular Weight: 441.44
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: OC[C@@H]1[C@@H](O)[C@H](O)C[S@@+]1C[C@@H](O)[C@H]1OC(c2ccc(C(F)(F)F)cc2)OC[C@H]1O.[Cl-]
Standard InChI: InChI=1S/C18H24F3O7S.ClH/c19-18(20,21)10-3-1-9(2-4-10)17-27-6-11(23)16(28-17)13(25)8-29-7-12(24)15(26)14(29)5-22;/h1-4,11-17,22-26H,5-8H2;1H/q+1;/p-1/t11-,12-,13-,14-,15+,16+,17?,29+;/m1./s1
Standard InChI Key: CAJKDVQRLKYDKS-NJJBDQDQSA-M
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
1.1421 -0.6457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1421 0.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8572 0.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5448 0.1792 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.3150 0.5092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4800 1.3344 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8749 1.8845 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8650 -0.0956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6901 -0.0132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4525 -0.8107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7825 -1.5533 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6548 -0.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4270 0.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4270 1.4169 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1421 1.8295 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2879 1.8295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0031 1.4169 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0031 0.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2879 0.1792 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7182 0.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7182 -0.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4333 -1.0583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1484 -0.6457 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1484 0.1792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4333 0.5918 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4270 -0.2339 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.8636 -1.0586 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8636 -1.8845 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.2773 -0.3421 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-4.6901 -1.0586 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2.5448 1.0044 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 1
2 3 1 0
4 3 1 1
4 5 1 0
5 6 1 6
6 7 1 0
5 8 1 0
8 9 1 1
8 10 1 0
10 11 1 6
10 12 1 0
4 12 1 0
2 13 1 0
13 14 1 0
14 15 1 1
14 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
13 19 1 0
18 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
20 25 1 0
13 26 1 6
23 27 1 0
27 28 1 0
27 29 1 0
27 30 1 0
M CHG 2 4 1 31 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 441.44Molecular Weight (Monoisotopic): 441.1189AlogP: -0.44#Rotatable Bonds: 5Polar Surface Area: 119.61Molecular Species: NEUTRALHBA: 7HBD: 5#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 5#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.37CX Basic pKa: ┄CX LogP: -1.60CX LogD: -1.60Aromatic Rings: 1Heavy Atoms: 29QED Weighted: 0.39Np Likeness Score: 1.31
References 1. Lu L, Chen J, Tao W, Wang Z, Liu D, Zhou J, Wu X, Sun H, Li W, Tanabe G, Muraoka O, Zhao B, Wu L, Xie W.. (2023) Design and Synthesis of Sulfonium Derivatives: A Novel Class of α-Glucosidase Inhibitors with Potent In Vivo Antihyperglycemic Activities., 66 (5): [PMID:36812150 ] [10.1021/acs.jmedchem.2c01984 ]