The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
phenyl-2-((4-(4-(dimethylamino)piperidin-1-yl)-2-methoxyphenyl)amino)-4-(1H-indol-3-yl)pyrimidin-5-carboxylate ID: ALA5270693
Max Phase: Preclinical
Molecular Formula: C33H34N6O3
Molecular Weight: 562.67
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCC(N(C)C)CC2)ccc1Nc1ncc(C(=O)Oc2ccccc2)c(-c2c[nH]c3ccccc23)n1
Standard InChI: InChI=1S/C33H34N6O3/c1-38(2)22-15-17-39(18-16-22)23-13-14-29(30(19-23)41-3)36-33-35-21-27(32(40)42-24-9-5-4-6-10-24)31(37-33)26-20-34-28-12-8-7-11-25(26)28/h4-14,19-22,34H,15-18H2,1-3H3,(H,35,36,37)
Standard InChI Key: PTQTXSUYGYJJKM-UHFFFAOYSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
-4.3006 0.2419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6017 -0.1965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8727 0.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8424 1.0139 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1739 -0.2489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4442 0.1359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7436 -0.2993 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7728 -1.1279 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5028 -1.5213 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2032 -1.0775 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0720 -1.5633 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.6552 -1.1742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3602 -1.6107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0930 -1.2228 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1138 -0.3938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4088 0.0426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6831 -0.3497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8394 -0.0016 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.5482 -0.4318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2775 -0.0374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2981 0.7871 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5969 1.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8675 0.8270 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0239 1.1796 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.0469 2.0042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7265 0.7473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3323 -2.4352 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6044 -2.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4153 0.9604 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0698 1.4721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7852 2.2525 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9550 2.2234 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7262 1.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0747 1.2280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6501 1.8199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4217 2.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3819 2.8233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0300 -0.1439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7265 0.2938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.6963 1.1187 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9713 1.5042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2702 1.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
5 10 2 0
8 11 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 17 2 0
12 17 1 0
15 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
18 23 1 0
21 24 1 0
24 25 1 0
24 26 1 0
13 27 1 0
27 28 1 0
6 29 1 0
29 30 2 0
30 31 1 0
31 32 1 0
32 33 2 0
33 29 1 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
32 37 1 0
38 1 2 0
39 38 1 0
40 39 2 0
41 40 1 0
42 41 2 0
1 42 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 562.67Molecular Weight (Monoisotopic): 562.2692AlogP: 6.13#Rotatable Bonds: 8Polar Surface Area: 95.61Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.06CX Basic pKa: 9.78CX LogP: 5.94CX LogD: 3.59Aromatic Rings: 5Heavy Atoms: 42QED Weighted: 0.17Np Likeness Score: -1.10
References 1. Grabe T, Jeyakumar K, Niggenaber J, Schulz T, Koska S, Kleinbölting S, Beck ME, Müller MP, Rauh D.. (2023) Addressing the Osimertinib Resistance Mutation EGFR-L858R/C797S with Reversible Aminopyrimidines., 14 (5): [PMID:37197473 ] [10.1021/acsmedchemlett.2c00514 ]