ethyl 5-[(E)-[[3-[[[4-[(2-methylbenzimidazol-1-yl)methyl]phenyl]sulfonylamino]methyl]phenyl]-(3-pyridyl)methylene]amino]oxypentanoate

ID: ALA5270846

Max Phase: Preclinical

Molecular Formula: C35H37N5O5S

Molecular Weight: 639.78

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOC(=O)CCCCO/N=C(/c1cccnc1)c1cccc(CNS(=O)(=O)c2ccc(Cn3c(C)nc4ccccc43)cc2)c1

Standard InChI:  InChI=1S/C35H37N5O5S/c1-3-44-34(41)15-6-7-21-45-39-35(30-12-9-20-36-24-30)29-11-8-10-28(22-29)23-37-46(42,43)31-18-16-27(17-19-31)25-40-26(2)38-32-13-4-5-14-33(32)40/h4-5,8-14,16-20,22,24,37H,3,6-7,15,21,23,25H2,1-2H3/b39-35+

Standard InChI Key:  RDUJSUBECFEVDI-IGIMMJHKSA-N

Molfile:  

 
     RDKit          2D

 46 50  0  0  0  0  0  0  0  0999 V2000
   -4.1987    1.2913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4842    1.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7722    1.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7722    0.4665    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4823    0.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1987    0.4628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9133    0.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6280    0.4628    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0576    1.7042    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3430    1.2917    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6283    1.7042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0862    1.2917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4702    2.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6450    2.4189    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3426    0.0502    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9613    0.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6307    1.3561    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8065    1.2637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2230    1.8472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5280   -0.7685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3323   -1.0190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9492   -0.4519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7688    0.3701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8010    1.7041    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5131    1.2921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5131    0.4667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8028    0.0547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0862    0.4630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8028   -0.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5174   -1.1830    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0882   -1.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0879   -2.0082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6248   -2.4189    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3397   -2.0062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3413   -1.1851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6294   -0.7686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2321   -0.7703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9467   -1.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6613   -0.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3760   -1.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0906   -0.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8053   -1.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5199   -0.7703    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.8053   -2.0081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2345   -1.1830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9492   -0.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  6  7  1  0
  7  8  1  0
  3  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
  9 13  2  0
  9 14  2  0
 15  8  1  0
 15 16  2  0
 16 17  1  0
 18 17  2  0
  8 18  1  0
 18 19  1  0
 15 20  1  0
 21 20  2  0
 22 21  1  0
 23 22  2  0
 16 23  1  0
 24 12  2  0
 25 24  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 12 28  1  0
 27 29  1  0
 29 30  2  0
 29 31  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 35 34  1  0
 36 35  2  0
 31 36  1  0
 30 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  1  0
 42 44  2  0
 43 45  1  0
 45 46  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5270846

    ---

Associated Targets(Human)

TBXAS1 Tchem Thromboxane-A synthase (3355 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 639.78Molecular Weight (Monoisotopic): 639.2515AlogP: 5.77#Rotatable Bonds: 15
Polar Surface Area: 124.77Molecular Species: NEUTRALHBA: 9HBD: 1
#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 10.31CX Basic pKa: 5.87CX LogP: 5.46CX LogD: 5.45
Aromatic Rings: 5Heavy Atoms: 46QED Weighted: 0.07Np Likeness Score: -1.26

References

1. Li X, Li X, Liu F, Li S, Shi D..  (2021)  Rational Multitargeted Drug Design Strategy from the Perspective of a Medicinal Chemist.,  64  (15.0): [PMID:34313432] [10.1021/acs.jmedchem.1c00683]

Source