(2S,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxy-N-(4-(pyrrolidin-1-yl)butyl)tetrahydrofuran-2-carboxamide

ID: ALA5270921

Max Phase: Preclinical

Molecular Formula: C18H27N7O4

Molecular Weight: 405.46

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1ncnc2c1ncn2[C@@H]1O[C@H](C(=O)NCCCCN2CCCC2)[C@@H](O)[C@H]1O

Standard InChI:  InChI=1S/C18H27N7O4/c19-15-11-16(22-9-21-15)25(10-23-11)18-13(27)12(26)14(29-18)17(28)20-5-1-2-6-24-7-3-4-8-24/h9-10,12-14,18,26-27H,1-8H2,(H,20,28)(H2,19,21,22)/t12-,13+,14-,18+/m0/s1

Standard InChI Key:  JMNRGOYZLMWBLZ-MOROJQBDSA-N

Molfile:  

 
     RDKit          2D

 29 32  0  0  0  0  0  0  0  0999 V2000
   -2.4448   -0.7259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1222   -0.9549    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9751   -1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1204   -1.8121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8019   -0.5511    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4499   -2.0503    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7834   -2.1946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5017   -0.9472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5062   -1.7788    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7826   -2.9520    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1957    0.0202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4427    0.2604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4384    1.0507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1888    1.2990    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6567    0.6621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7965    1.5117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4290    2.0520    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4470    0.6664    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0763    1.1863    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8749    2.2982    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5655    1.6473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2857    1.3220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9277    1.7830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6479    1.4575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2898    1.9186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0382    1.6732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5062    2.3100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0452    2.9520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2922    2.7117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  1  3  1  0
  2  4  2  0
  2  5  1  0
  3  6  2  0
  4  6  1  0
  4  7  1  0
  5  8  2  0
  7  9  2  0
  8  9  1  0
  7 10  1  0
 11  1  1  1
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 11  1  0
 13 16  1  1
 14 17  1  6
 15 18  1  6
 16 19  1  0
 16 20  2  0
 19 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5270921

    ---

Associated Targets(Human)

METTL3 Tbio N6-adenosine-methyltransferase catalytic subunit (617 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 405.46Molecular Weight (Monoisotopic): 405.2125AlogP: -0.98#Rotatable Bonds: 7
Polar Surface Area: 151.65Molecular Species: BASEHBA: 10HBD: 4
#RO5 Violations: HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 12.40CX Basic pKa: 9.83CX LogP: -1.35CX LogD: -3.75
Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.43Np Likeness Score: 0.00

References

1. Xu P, Ge R..  (2022)  Roles and drug development of METTL3 (methyltransferase-like 3) in anti-tumor therapy.,  230  [PMID:35063732] [10.1016/j.ejmech.2022.114118]

Source