methyl (1R,2S,3S,5S)-3-(3,4-dichlorophenyl)-8-oxabicyclo[3.2.1]octane-2-carboxylate

ID: ALA5271116

Max Phase: Preclinical

Molecular Formula: C15H16Cl2O3

Molecular Weight: 315.20

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COC(=O)[C@H]1[C@@H](c2ccc(Cl)c(Cl)c2)C[C@@H]2CC[C@H]1O2

Standard InChI:  InChI=1S/C15H16Cl2O3/c1-19-15(18)14-10(7-9-3-5-13(14)20-9)8-2-4-11(16)12(17)6-8/h2,4,6,9-10,13-14H,3,5,7H2,1H3/t9-,10+,13+,14-/m0/s1

Standard InChI Key:  DHXANQGCRAVCSQ-PJQZNRQZSA-N

Molfile:  

 
     RDKit          2D

 22 24  0  0  0  0  0  0  0  0999 V2000
    1.6438   -1.7735    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.2313   -1.0590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4068   -1.0590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0074   -0.3463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4052    0.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2277    0.3672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6404   -0.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4654   -0.3473    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.8322   -0.3463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2323   -1.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0570   -1.0515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4921   -0.6803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4921   -0.0081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0570    0.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4654    1.0640    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4654   -0.3463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2323    0.3630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8322    1.0640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2323    1.7735    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0570    1.7735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0074    1.0640    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4654   -1.7567    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  2  7  1  0
  7  6  2  0
  7  8  1  0
  9  4  1  1
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  6
 11 16  1  0
 16 14  1  0
  9 17  1  0
 17 14  1  0
 17 18  1  1
 19 18  1  0
 20 19  1  0
 21 18  2  0
 11 22  1  6
M  END

Alternative Forms

  1. Parent:

    ALA5271116

    ---

Associated Targets(Human)

SLC6A3 Tclin Dopamine transporter (10535 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC6A4 Tclin Serotonin transporter (12625 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 315.20Molecular Weight (Monoisotopic): 314.0476AlogP: 3.82#Rotatable Bonds: 2
Polar Surface Area: 35.53Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.65CX LogD: 3.65
Aromatic Rings: 1Heavy Atoms: 20QED Weighted: 0.78Np Likeness Score: 0.46

References

1. Wu YJ, Meanwell NA..  (2021)  Geminal Diheteroatomic Motifs: Some Applications of Acetals, Ketals, and Their Sulfur and Nitrogen Homologues in Medicinal Chemistry and Drug Design.,  64  (14.0): [PMID:34213340] [10.1021/acs.jmedchem.1c00790]

Source