The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
ID: ALA5271392
Max Phase: Preclinical
Molecular Formula: C22H24N2O4
Molecular Weight: 380.44
Associated Items:
Names and Identifiers Canonical SMILES: COCc1c(C(=O)OC(C)C)ncc2[nH]c3ccc4oc(C(C)C)cc4c3c12
Standard InChI: InChI=1S/C22H24N2O4/c1-11(2)18-8-13-17(28-18)7-6-15-19(13)20-14(10-26-5)21(22(25)27-12(3)4)23-9-16(20)24-15/h6-9,11-12,24H,10H2,1-5H3
Standard InChI Key: JFGUJXZLJIUVPZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
28 31 0 0 0 0 0 0 0 0999 V2000
1.3940 -1.3140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5731 -1.3969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0910 -0.7274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4297 0.0246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2505 0.1075 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7326 -0.5619 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7324 -0.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7324 -1.8287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0692 -2.0805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4596 -2.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1932 -1.8325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1932 -0.9841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4614 -0.5619 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0173 0.7390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8074 0.7390 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2199 1.4533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6629 0.8218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2505 1.5361 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4877 0.8218 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.9001 1.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7250 1.5361 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4877 2.2504 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8265 -0.3989 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4877 0.3529 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6439 0.2582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9001 1.0673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7250 1.0673 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4877 1.7816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 2 0
3 4 1 0
4 5 2 0
6 5 1 0
1 6 2 0
7 3 1 0
8 7 2 0
8 9 1 0
9 2 1 0
10 8 1 0
11 10 2 0
12 11 1 0
13 12 2 0
7 13 1 0
4 14 1 0
14 15 1 0
15 16 1 0
5 17 1 0
17 18 2 0
17 19 1 0
19 20 1 0
20 21 1 0
20 22 1 0
12 23 1 0
23 24 1 0
25 24 2 0
13 25 1 0
24 26 1 0
26 27 1 0
26 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 380.44Molecular Weight (Monoisotopic): 380.1736AlogP: 5.30#Rotatable Bonds: 5Polar Surface Area: 77.35Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.31CX Basic pKa: 1.75CX LogP: 3.96CX LogD: 3.96Aromatic Rings: 4Heavy Atoms: 28QED Weighted: 0.48Np Likeness Score: 0.13
References 1. Beato A, Gori A, Boucherle B, Peuchmaur M, Haudecoeur R.. (2021) β-Carboline as a Privileged Scaffold for Multitarget Strategies in Alzheimer's Disease Therapy., 64 (3.0): [PMID:33528252 ] [10.1021/acs.jmedchem.0c01887 ]