The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((4-(4-chlorophenyl)-6-(4-nitrophenyl)pyrimidin-2-yl)thio)-N-(4-(3-(3,4-dimethoxyphenyl)acryloyl)phenyl)acetamide ID: ALA5271424
Max Phase: Preclinical
Molecular Formula: C35H27ClN4O6S
Molecular Weight: 667.14
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(/C=C/C(=O)c2ccc(NC(=O)CSc3nc(-c4ccc(Cl)cc4)cc(-c4ccc([N+](=O)[O-])cc4)n3)cc2)cc1OC
Standard InChI: InChI=1S/C35H27ClN4O6S/c1-45-32-18-4-22(19-33(32)46-2)3-17-31(41)25-7-13-27(14-8-25)37-34(42)21-47-35-38-29(23-5-11-26(36)12-6-23)20-30(39-35)24-9-15-28(16-10-24)40(43)44/h3-20H,21H2,1-2H3,(H,37,42)/b17-3+
Standard InChI Key: ICCOWNACKHICCL-IJUHEHPCSA-N
Molfile:
RDKit 2D
47 51 0 0 0 0 0 0 0 0999 V2000
-4.2852 -0.4116 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5706 0.0006 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8587 -0.4112 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8587 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5688 -1.6482 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-4.2852 -1.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5706 0.8258 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2851 1.2386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2843 2.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5695 2.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8577 2.0649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8529 1.2401 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9998 -1.6527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0000 -2.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7129 -2.8886 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4277 -2.4759 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4294 -1.6548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7175 -1.2383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5695 3.2992 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8549 3.7118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2841 3.7118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1441 -1.6490 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.4294 -1.2364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 -1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0002 -1.2364 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7147 -2.4742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -1.6490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4292 -1.2366 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1413 -1.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1413 -2.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4310 -2.8860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -2.4777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8559 -2.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5706 -2.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8559 -3.7118 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2852 -2.8866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9998 -2.4740 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0001 -1.6488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7130 -1.2381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4278 -1.6508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4294 -2.4719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7176 -2.8884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1424 -1.2382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.1424 -0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.1424 -2.8885 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.7130 -0.4129 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.9983 -0.0003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
7 2 1 0
8 7 2 0
9 8 1 0
10 9 2 0
11 10 1 0
7 12 1 0
12 11 2 0
13 6 1 0
14 13 2 0
15 14 1 0
16 15 2 0
17 16 1 0
13 18 1 0
18 17 2 0
19 10 1 0
19 20 1 0
19 21 2 0
4 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
25 27 1 0
28 27 2 0
29 28 1 0
30 29 2 0
31 30 1 0
32 31 2 0
27 32 1 0
30 33 1 0
33 34 1 0
33 35 2 0
34 36 2 0
36 37 1 0
38 37 2 0
39 38 1 0
40 39 2 0
41 40 1 0
42 41 2 0
37 42 1 0
40 43 1 0
43 44 1 0
16 45 1 0
39 46 1 0
46 47 1 0
M CHG 2 19 1 20 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 667.14Molecular Weight (Monoisotopic): 666.1340AlogP: 8.02#Rotatable Bonds: 12Polar Surface Area: 133.55Molecular Species: NEUTRALHBA: 9HBD: 1#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 13.16CX Basic pKa: 2.72CX LogP: 8.17CX LogD: 8.17Aromatic Rings: 5Heavy Atoms: 47QED Weighted: 0.04Np Likeness Score: -1.22
References 1. Dong J, Cheng XD, Zhang WD, Qin JJ.. (2021) Recent Update on Development of Small-Molecule STAT3 Inhibitors for Cancer Therapy: From Phosphorylation Inhibition to Protein Degradation., 64 (13.0): [PMID:34170703 ] [10.1021/acs.jmedchem.1c00629 ]