Isomalyngamides B

ID: ALA5271541

Max Phase: Preclinical

Molecular Formula: C29H47ClN2O6

Molecular Weight: 555.16

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCC[C@@H](C/C=C/CCC(=O)N(C)C/C(=C\Cl)C/C(=C\C(=O)N1C[C@H](O)CC1=O)OC)OC

Standard InChI:  InChI=1S/C29H47ClN2O6/c1-5-6-7-8-9-11-14-25(37-3)15-12-10-13-16-27(34)31(2)21-23(20-30)17-26(38-4)19-29(36)32-22-24(33)18-28(32)35/h10,12,19-20,24-25,33H,5-9,11,13-18,21-22H2,1-4H3/b12-10+,23-20-,26-19+/t24-,25+/m1/s1

Standard InChI Key:  KGWVAVKMYWVXPB-KYOZZOOHSA-N

Molfile:  

 
     RDKit          2D

 38 38  0  0  0  0  0  0  0  0999 V2000
   -3.1380    0.5077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4235    0.0952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4235   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7091   -1.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9946   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2801   -1.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4343   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1487   -1.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8632   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8632    0.0952    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5777   -1.1422    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5777   -1.9671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2921   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0066   -1.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0066   -1.9671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2921   -2.3797    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.7211   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4355   -1.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4355   -1.9671    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1499   -2.3797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1499   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1499    0.0952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4355    0.5077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8644    0.5077    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6471    0.2619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8607   -0.5349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1390    0.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6684    1.5828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8819    2.3797    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8644    1.3327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1380   -1.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8525   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5669   -1.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2814   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9958   -1.1422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7103   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4245   -1.1420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1390   -0.7296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  6
  3  4  1  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
  9 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  2  0
 21 22  1  0
 22 23  2  0
 22 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 28 27  1  0
 28 29  1  6
 30 28  1  0
 30 24  1  0
 31  3  1  0
 32 31  1  0
 33 32  1  0
 34 33  1  0
 35 34  1  0
 36 35  1  0
 37 36  1  0
 37 38  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5271541

    ---

Associated Targets(non-human)

L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 555.16Molecular Weight (Monoisotopic): 554.3123AlogP: 5.10#Rotatable Bonds: 19
Polar Surface Area: 96.38Molecular Species: NEUTRALHBA: 6HBD: 1
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: CX Basic pKa: CX LogP: 3.65CX LogD: 3.65
Aromatic Rings: Heavy Atoms: 38QED Weighted: 0.10Np Likeness Score: 1.30

References

1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L..  (2020)  Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species.,  201  [PMID:32652435] [10.1016/j.ejmech.2020.112473]

Source