N-(1,5-dimethyl-3-oxo-2-phenyl-2,3-dihydro-1H-pyrazol-4-yl)-6-phenylpyrazolo[1,5-a]pyrimidine-3-carboxamide

ID: ALA5271553

Max Phase: Preclinical

Molecular Formula: C24H20N6O2

Molecular Weight: 424.46

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1c(NC(=O)c2cnn3cc(-c4ccccc4)cnc23)c(=O)n(-c2ccccc2)n1C

Standard InChI:  InChI=1S/C24H20N6O2/c1-16-21(24(32)30(28(16)2)19-11-7-4-8-12-19)27-23(31)20-14-26-29-15-18(13-25-22(20)29)17-9-5-3-6-10-17/h3-15H,1-2H3,(H,27,31)

Standard InChI Key:  DUALKAQETUHZCA-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    0.0009   -2.4799    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7153   -2.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4297   -2.4799    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4297   -1.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7153   -1.2425    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0009   -1.6550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8028   -1.4049    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2736   -2.0584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7815   -2.7258    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0163   -0.6084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8128   -0.3951    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0261    0.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8224    0.6153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8557    1.4562    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1027    1.7412    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5859    1.0934    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4056    0.0325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4332   -0.0254    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1439   -2.8924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8581   -2.4801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5698   -2.8918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5698   -3.7167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8599   -4.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1439   -3.7204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7613    1.0934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5698    1.8685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8893    2.5378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4723    3.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2588    3.9150    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4620    4.1285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8807    3.5494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0893    2.7521    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  1  6  1  0
  6  5  1  0
  6  7  2  0
  7  8  1  0
  9  8  2  0
  1  9  1  0
  7 10  1  0
 10 11  1  0
 11 12  1  0
 13 12  2  0
 13 14  1  0
 14 15  1  0
 16 15  1  0
 12 16  1  0
 13 17  1  0
 10 18  2  0
  3 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 23 22  1  0
 24 23  2  0
 19 24  1  0
 16 25  2  0
 14 26  1  0
 15 27  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 27 32  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5271553

    ---

Associated Targets(non-human)

CHO-K1 (1115 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 424.46Molecular Weight (Monoisotopic): 424.1648AlogP: 3.45#Rotatable Bonds: 4
Polar Surface Area: 86.22Molecular Species: NEUTRALHBA: 7HBD: 1
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 1#RO5 Violations (Lipinski):
CX Acidic pKa: 9.98CX Basic pKa: 0.41CX LogP: 2.33CX LogD: 2.33
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.48Np Likeness Score: -1.81

References

1. Hammouda MM, Gaffer HE, Elattar KM..  (2022)  Insights into the medicinal chemistry of heterocycles integrated with a pyrazolo[1,5-a]pyrimidine scaffold.,  13  (10.0): [PMID:36325400] [10.1039/d2md00192f]

Source