The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-hydroxy-7,8-dimethoxyserrulat-14-en-19-oic acid methyl ester ID: ALA5271594
Max Phase: Preclinical
Molecular Formula: C23H34O5
Molecular Weight: 390.52
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1cc2c(c(OC)c1OC)[C@H](C)C[C@@H](O)[C@H]2[C@@H](C)CCC=C(C)C
Standard InChI: InChI=1S/C23H34O5/c1-13(2)9-8-10-14(3)19-16-12-17(23(25)28-7)21(26-5)22(27-6)20(16)15(4)11-18(19)24/h9,12,14-15,18-19,24H,8,10-11H2,1-7H3/t14-,15+,18+,19-/m0/s1
Standard InChI Key: DFSZRMLMJHCTHC-SFUIVIKGSA-N
Molfile:
RDKit 2D
29 30 0 0 0 0 0 0 0 0999 V2000
-0.3543 1.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3601 2.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0721 1.6580 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0721 0.8328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3620 0.4209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3543 0.8290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0718 0.4149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7893 0.8291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7893 1.6576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0718 2.0718 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0718 2.9001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3601 2.8981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7893 2.0721 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7893 0.4186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5066 0.8328 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7893 -0.4096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5066 0.4149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0718 -0.4133 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3546 -0.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7891 -0.8274 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7891 -1.6557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0718 -2.0699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0718 -2.8981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3546 -3.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7891 -3.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7891 0.0007 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.3570 3.3123 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7893 2.9004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5066 1.6610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
6 7 1 0
8 7 1 0
9 8 1 0
10 9 1 0
1 10 1 0
10 11 1 1
2 12 1 0
3 13 1 0
4 14 1 0
14 15 1 0
14 16 2 0
8 17 1 6
7 18 1 0
18 19 1 1
18 20 1 0
20 21 1 0
21 22 1 0
22 23 2 0
23 24 1 0
23 25 1 0
7 26 1 1
12 27 1 0
13 28 1 0
15 29 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 390.52Molecular Weight (Monoisotopic): 390.2406AlogP: 4.82#Rotatable Bonds: 7Polar Surface Area: 64.99Molecular Species: NEUTRALHBA: 5HBD: 1#RO5 Violations: ┄HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 4.77CX LogD: 4.77Aromatic Rings: 1Heavy Atoms: 28QED Weighted: 0.53Np Likeness Score: 1.69
References 1. Zhang C, Lum KY, Taki AC, Gasser RB, Byrne JJ, Montaner LJ, Tietjen I, Avery VM, Davis RA.. (2023) Using a Bioactive Eremophila -Derived Serrulatane Scaffold to Generate a Unique Carbamate Library for Anti-infective Evaluations., 86 (3): [PMID:36799121 ] [10.1021/acs.jnatprod.2c01041 ]