Henryin

ID: ALA5271596

Max Phase: Preclinical

Molecular Formula: C22H32O6

Molecular Weight: 392.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C1C(=O)[C@@]23[C@H](O)C[C@@H]4C(C)(C)CC[C@H](O)[C@@]4(COC(C)=O)[C@@H]2CC[C@H]1[C@H]3O

Standard InChI:  InChI=1S/C22H32O6/c1-11-13-5-6-14-21(10-28-12(2)23)15(20(3,4)8-7-16(21)24)9-17(25)22(14,18(11)26)19(13)27/h13-17,19,24-25,27H,1,5-10H2,2-4H3/t13-,14+,15-,16+,17-,19-,21+,22+/m1/s1

Standard InChI Key:  FWBSIMCZPHJUNZ-SPYHJPNNSA-N

Molfile:  

 
     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
    0.3144   -0.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1098   -0.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0223   -0.8808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3977   -0.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7512    0.3560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0348   -0.0562    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1098   -1.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0390    0.7683    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3144   -1.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3977   -1.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8220   -1.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0515    0.4185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3977    0.7808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3227    1.1931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8220   -0.0520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7387   -1.2931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8344    1.5929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5508    0.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1223    1.1806    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5341   -1.2931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8386    2.4175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5341   -0.4685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7470   -0.4685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0348   -1.7054    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8220    0.7725    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4097   -2.4175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2343   -2.4175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5508    1.1806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1223   -2.1177    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3144    0.3685    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7512    1.1806    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  4  1  0
  1  3  1  1
  4  1  1  0
  5  3  1  0
  6  1  1  0
  7 10  1  0
  8  6  1  0
  9  1  1  0
 10  9  1  0
 11  7  1  0
  2 12  1  6
 13  4  1  0
 14  8  1  0
 15  2  1  0
 16  3  2  0
 17 19  1  0
 18  5  2  0
 19 12  1  0
 20 11  1  0
 21 17  2  0
 22 15  1  0
  6 23  1  1
  9 24  1  6
 15 25  1  6
 26 11  1  0
 27 11  1  0
 28 17  1  0
  7 29  1  1
  4 30  1  1
  8 31  1  1
  8  5  1  0
  7  2  1  0
 14 13  1  0
 20 22  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5271596

    ---

Associated Targets(Human)

SW480 (6023 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 392.49Molecular Weight (Monoisotopic): 392.2199AlogP: 1.61#Rotatable Bonds: 2
Polar Surface Area: 104.06Molecular Species: NEUTRALHBA: 6HBD: 3
#RO5 Violations: HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 13.86CX Basic pKa: CX LogP: 1.01CX LogD: 1.01
Aromatic Rings: Heavy Atoms: 28QED Weighted: 0.49Np Likeness Score: 3.22

References

1. Phull MS, Jadav SS, Gundla R, Mainkar PS..  (2021)  A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors.,  212  [PMID:33445154] [10.1016/j.ejmech.2020.113149]

Source