The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Henryin ID: ALA5271596
Max Phase: Preclinical
Molecular Formula: C22H32O6
Molecular Weight: 392.49
Associated Items:
Names and Identifiers Canonical SMILES: C=C1C(=O)[C@@]23[C@H](O)C[C@@H]4C(C)(C)CC[C@H](O)[C@@]4(COC(C)=O)[C@@H]2CC[C@H]1[C@H]3O
Standard InChI: InChI=1S/C22H32O6/c1-11-13-5-6-14-21(10-28-12(2)23)15(20(3,4)8-7-16(21)24)9-17(25)22(14,18(11)26)19(13)27/h13-17,19,24-25,27H,1,5-10H2,2-4H3/t13-,14+,15-,16+,17-,19-,21+,22+/m1/s1
Standard InChI Key: FWBSIMCZPHJUNZ-SPYHJPNNSA-N
Molfile:
RDKit 2D
31 34 0 0 0 0 0 0 0 0999 V2000
0.3144 -0.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1098 -0.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0223 -0.8808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3977 -0.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7512 0.3560 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0348 -0.0562 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1098 -1.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0390 0.7683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3144 -1.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3977 -1.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8220 -1.7054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0515 0.4185 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3977 0.7808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3227 1.1931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8220 -0.0520 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7387 -1.2931 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8344 1.5929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5508 0.5601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1223 1.1806 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5341 -1.2931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8386 2.4175 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5341 -0.4685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7470 -0.4685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0348 -1.7054 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8220 0.7725 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4097 -2.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2343 -2.4175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5508 1.1806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1223 -2.1177 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.3144 0.3685 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
1.7512 1.1806 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2 4 1 0
1 3 1 1
4 1 1 0
5 3 1 0
6 1 1 0
7 10 1 0
8 6 1 0
9 1 1 0
10 9 1 0
11 7 1 0
2 12 1 6
13 4 1 0
14 8 1 0
15 2 1 0
16 3 2 0
17 19 1 0
18 5 2 0
19 12 1 0
20 11 1 0
21 17 2 0
22 15 1 0
6 23 1 1
9 24 1 6
15 25 1 6
26 11 1 0
27 11 1 0
28 17 1 0
7 29 1 1
4 30 1 1
8 31 1 1
8 5 1 0
7 2 1 0
14 13 1 0
20 22 1 0
M END Associated Targets(Human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 392.49Molecular Weight (Monoisotopic): 392.2199AlogP: 1.61#Rotatable Bonds: 2Polar Surface Area: 104.06Molecular Species: NEUTRALHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.86CX Basic pKa: ┄CX LogP: 1.01CX LogD: 1.01Aromatic Rings: ┄Heavy Atoms: 28QED Weighted: 0.49Np Likeness Score: 3.22
References 1. Phull MS, Jadav SS, Gundla R, Mainkar PS.. (2021) A perspective on medicinal chemistry approaches towards adenomatous polyposis coli and Wnt signal based colorectal cancer inhibitors., 212 [PMID:33445154 ] [10.1016/j.ejmech.2020.113149 ]