3-(8-ethyl-2-methyl-1,2,3,4-tetrahydro-5H-pyrido[4,3-b]indol-5-yl)-1-(10H-phenothiazin-10-yl)propan-1-one

ID: ALA5271717

Max Phase: Preclinical

Molecular Formula: C29H29N3OS

Molecular Weight: 467.64

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1ccc2c(c1)c1c(n2CCC(=O)N2c3ccccc3Sc3ccccc32)CCN(C)C1

Standard InChI:  InChI=1S/C29H29N3OS/c1-3-20-12-13-23-21(18-20)22-19-30(2)16-14-24(22)31(23)17-15-29(33)32-25-8-4-6-10-27(25)34-28-11-7-5-9-26(28)32/h4-13,18H,3,14-17,19H2,1-2H3

Standard InChI Key:  OYEGLWXFKBBXHP-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
   -0.4949    0.9753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2117    1.3837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2117    2.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4967    2.6252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2155    2.2130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2155    1.3874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0008    1.1322    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4861    1.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0008    2.4682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3362    3.2199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1575    3.3064    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6418    2.6428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3107    1.8870    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5703    4.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2144    0.3346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6306   -0.2491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8443   -1.0467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2605   -1.6305    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6419   -1.2604    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4742   -2.4281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1096   -3.0119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9071   -2.7982    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1209   -2.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5370   -1.4168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2691   -2.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4831   -3.4393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9034   -4.0215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1052   -3.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9158   -1.7871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1298   -0.9894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5502   -0.4073    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7518   -0.6159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9268    2.6255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6418    2.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  8  7  1  0
  9  8  2  0
  5  9  1  0
  9 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  8 13  1  0
 11 14  1  0
  7 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 20 18  1  0
 21 20  2  0
 22 21  1  0
 23 22  1  0
 24 23  2  0
 18 24  1  0
 20 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 21 28  1  0
 23 29  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 24 32  1  0
  3 33  1  0
 33 34  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5271717

    ---

Associated Targets(Human)

GRIN2B Tclin Glutamate [NMDA] receptor subunit epsilon 2 (467 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 467.64Molecular Weight (Monoisotopic): 467.2031AlogP: 6.41#Rotatable Bonds: 4
Polar Surface Area: 28.48Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.12CX LogP: 5.81CX LogD: 5.63
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.35Np Likeness Score: -0.98

References

1. Dai J, Dan W, Zhang Y, Wang J..  (2018)  Recent developments on synthesis and biological activities of γ-carboline.,  157  [PMID:30103193] [10.1016/j.ejmech.2018.08.015]

Source