The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Isopropyl ((S)-(1(4R,5R)-5-(4-Amino-2-oxopyrimidin-1(2H)-yl)-4-hydroxy-4,5-dihydrofuran-2-yl)methoxy)(phenoxy)phosphoryl)-L-alaninate ID: ALA5271779
Max Phase: Preclinical
Molecular Formula: C21H27N4O8P
Molecular Weight: 494.44
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)OC(=O)[C@H](C)N[P@@](=O)(OCC1=C[C@@H](O)[C@H](n2ccc(N)nc2=O)O1)Oc1ccccc1
Standard InChI: InChI=1S/C21H27N4O8P/c1-13(2)31-20(27)14(3)24-34(29,33-15-7-5-4-6-8-15)30-12-16-11-17(26)19(32-16)25-10-9-18(22)23-21(25)28/h4-11,13-14,17,19,26H,12H2,1-3H3,(H,24,29)(H2,22,23,28)/t14-,17+,19+,34+/m0/s1
Standard InChI Key: LWNCAGWHAKUXIC-CFLCUWIBSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
0.8987 -0.2135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1221 -1.0077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9464 -1.0406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2325 -0.2668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5850 0.2443 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1016 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0296 -0.0532 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.2432 0.7438 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0401 0.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6237 0.3738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4102 -0.4232 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6131 -0.6368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4208 0.5874 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.3995 -1.4339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3590 -1.7553 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4818 -0.5834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2790 -0.3698 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-1.8625 -0.9534 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6596 -0.7398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2431 -1.3233 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8732 0.0572 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0296 -2.1204 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.0401 -1.1096 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.6237 -1.6932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.4208 -1.4796 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4102 -2.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8656 0.3461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6908 0.3461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2782 1.0607 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1035 1.0610 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5142 1.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1014 2.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2804 2.4903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8638 1.7785 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
4 3 1 0
5 4 1 0
1 5 1 0
1 6 1 0
4 7 1 1
8 7 1 0
9 8 2 0
10 9 1 0
11 10 2 0
12 11 1 0
7 12 1 0
10 13 1 0
12 14 2 0
3 15 1 6
6 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
19 21 1 6
20 22 2 0
20 23 1 0
23 24 1 0
24 25 1 0
24 26 1 0
17 27 1 6
17 28 2 0
27 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 494.44Molecular Weight (Monoisotopic): 494.1567AlogP: 1.73#Rotatable Bonds: 10Polar Surface Area: 164.23Molecular Species: NEUTRALHBA: 11HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 1CX Acidic pKa: 10.23CX Basic pKa: ┄CX LogP: 0.32CX LogD: 0.32Aromatic Rings: 2Heavy Atoms: 34QED Weighted: 0.33Np Likeness Score: 0.30
References 1. Passow KT, Caldwell HS, Ngo KA, Arnold JJ, Antczak NM, Narayanan A, Jose J, Sturla SJ, Cameron CE, Ciota AT, Harki DA.. (2021) A Chemical Strategy for Intracellular Arming of an Endogenous Broad-Spectrum Antiviral Nucleotide., 64 (20.0): [PMID:34661397 ] [10.1021/acs.jmedchem.1c01481 ]