4,4-difluorocyclohexyl ((S)-4-methyl-1-oxo-1-(((S)-1-oxo-3-((S)-2-oxopyrrolidin-3-yl)propan-2-yl)amino)pentan-2-yl)carbamate

ID: ALA5271899

Max Phase: Preclinical

Molecular Formula: C20H31F2N3O5

Molecular Weight: 431.48

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)OC1CCC(F)(F)CC1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O

Standard InChI:  InChI=1S/C20H31F2N3O5/c1-12(2)9-16(25-19(29)30-15-3-6-20(21,22)7-4-15)18(28)24-14(11-26)10-13-5-8-23-17(13)27/h11-16H,3-10H2,1-2H3,(H,23,27)(H,24,28)(H,25,29)/t13-,14-,16-/m0/s1

Standard InChI Key:  PHUZMTSQHVZDOX-DZKIICNBSA-N

Molfile:  

 
     RDKit          2D

 30 31  0  0  0  0  0  0  0  0999 V2000
   -3.0980   -0.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3835   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3835   -1.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0980   -1.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8124   -1.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8124   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6390   -1.3214    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2257   -2.0354    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6690   -0.0839    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9546   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9546   -1.3214    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2401   -0.0839    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4742   -0.4964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4742   -1.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1888   -1.7339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1888   -2.5589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9032   -1.3214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1888   -0.0839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9032   -0.4963    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6182   -0.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3330   -0.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3330   -1.3208    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6182    0.7419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3330    1.1546    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4193    1.9751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8355    2.5589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2264    2.1467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.6390    1.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0868    0.8190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1888    0.7411    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  3  1  0
  5  4  1  0
  1  6  1  0
  6  5  1  0
  5  7  1  0
  5  8  1  0
  9  2  1  0
 10  9  1  0
 10 11  2  0
 12 10  1  0
 13 12  1  0
 13 14  1  6
 14 15  1  0
 15 16  1  0
 15 17  1  0
 18 13  1  0
 19 18  1  0
 20 19  1  1
 20 21  1  0
 21 22  2  0
 20 23  1  0
 24 23  1  1
 25 24  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 24 29  1  0
 18 30  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5271899

    ---

Associated Targets(Human)

Huh-7 (12904 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

SARS-CoV-2 (38078 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
L929 (3802 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.48Molecular Weight (Monoisotopic): 431.2232AlogP: 1.92#Rotatable Bonds: 9
Polar Surface Area: 113.60Molecular Species: NEUTRALHBA: 5HBD: 3
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski):
CX Acidic pKa: 12.58CX Basic pKa: CX LogP: 0.84CX LogD: 0.84
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.48Np Likeness Score: 0.63

References

1. Gao K, Wang R, Chen J, Tepe JJ, Huang F, Wei GW..  (2021)  Perspectives on SARS-CoV-2 Main Protease Inhibitors.,  64  (23.0): [PMID:34798775] [10.1021/acs.jmedchem.1c00409]

Source