The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(dimethylamino)ethyl)-6-morpholino-5-nitro-1H-benzo[de]isoquinoline-1,3(2H)-dione ID: ALA5271947
Max Phase: Preclinical
Molecular Formula: C20H22N4O5
Molecular Weight: 398.42
Associated Items:
Names and Identifiers Canonical SMILES: CN(C)CCN1C(=O)c2cccc3c(N4CCOCC4)c([N+](=O)[O-])cc(c23)C1=O
Standard InChI: InChI=1S/C20H22N4O5/c1-21(2)6-7-23-19(25)14-5-3-4-13-17(14)15(20(23)26)12-16(24(27)28)18(13)22-8-10-29-11-9-22/h3-5,12H,6-11H2,1-2H3
Standard InChI Key: YICITURDSUXCOR-UHFFFAOYSA-N
Molfile:
RDKit 2D
29 32 0 0 0 0 0 0 0 0999 V2000
-0.7114 -1.0328 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7127 -0.2078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0008 0.2039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7144 -0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7176 -1.0280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0068 -1.4458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4331 -1.4373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1395 -1.0201 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1346 -0.2034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4218 0.2041 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4268 1.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7114 1.4430 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0024 1.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7178 1.4404 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.7099 2.2682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1406 1.4457 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4253 -1.4468 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1406 -1.0356 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4238 -2.2719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0068 -2.2709 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7213 -2.6835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7213 -3.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0067 -3.9212 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.7078 -3.5087 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7078 -2.6835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4237 2.6821 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4222 3.5073 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.1360 3.9212 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7075 3.9199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
4 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
3 13 1 0
13 14 2 0
12 15 1 0
11 16 2 0
17 1 1 0
17 18 1 0
17 19 2 0
20 6 1 0
20 21 1 0
22 21 1 0
23 22 1 0
24 23 1 0
20 25 1 0
25 24 1 0
15 26 1 0
26 27 1 0
27 28 1 0
27 29 1 0
M CHG 2 17 1 18 -1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 398.42Molecular Weight (Monoisotopic): 398.1590AlogP: 1.74#Rotatable Bonds: 5Polar Surface Area: 96.23Molecular Species: BASEHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 8.52CX LogP: 1.75CX LogD: 0.61Aromatic Rings: 2Heavy Atoms: 29QED Weighted: 0.43Np Likeness Score: -1.33
References 1. Chen XM, Zhou JY, Liu SQ, Song LH, Wang HL, Wang Q, Liang SM, Lu L, Wei JH, Huang R, Zhang Y.. (2023) Design, synthesis, and antitumor evaluation of morpholine substituted bisnaphthalimides as DNA targeting agents., 85 [PMID:36894107 ] [10.1016/j.bmcl.2023.129218 ]