The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(1-(2-((Benzyloxy)amino)-2-oxoethyl)-1H-pyrrole-3-carbonyl)glycyl-L-valine ID: ALA5271986
Max Phase: Preclinical
Molecular Formula: C21H26N4O6
Molecular Weight: 430.46
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)[C@H](NC(=O)CNC(=O)c1ccn(CC(=O)NOCc2ccccc2)c1)C(=O)O
Standard InChI: InChI=1S/C21H26N4O6/c1-14(2)19(21(29)30)23-17(26)10-22-20(28)16-8-9-25(11-16)12-18(27)24-31-13-15-6-4-3-5-7-15/h3-9,11,14,19H,10,12-13H2,1-2H3,(H,22,28)(H,23,26)(H,24,27)(H,29,30)/t19-/m0/s1
Standard InChI Key: HMPNDLUYODHTLT-IBGZPJMESA-N
Molfile:
RDKit 2D
31 32 0 0 0 0 0 0 0 0999 V2000
-3.8419 0.6165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1274 1.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1274 1.8542 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4128 0.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6981 1.0290 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9835 0.6164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2688 1.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9835 -0.2087 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1826 1.8492 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6241 2.0208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0365 1.3065 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4845 0.6935 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8617 1.3065 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2743 0.5919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0995 0.5919 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8617 -0.1227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5121 -0.1227 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.3373 -0.1227 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7499 -0.8374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5565 1.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2712 0.6165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9859 1.0291 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2712 -0.2086 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5565 1.8543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2712 2.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8419 2.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5752 -0.8376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9859 -1.5505 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5731 -2.2653 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7521 -2.2669 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3356 -1.5551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 1 0
6 7 1 0
6 8 2 0
9 7 1 0
9 10 2 0
10 11 1 0
11 12 1 0
12 7 2 0
11 13 1 0
13 14 1 0
14 15 1 0
14 16 2 0
15 17 1 0
17 18 1 0
18 19 1 0
1 20 1 0
20 21 1 0
21 22 1 0
21 23 2 0
20 24 1 6
24 25 1 0
24 26 1 0
27 19 2 0
28 27 1 0
29 28 2 0
30 29 1 0
31 30 2 0
19 31 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 430.46Molecular Weight (Monoisotopic): 430.1852AlogP: 0.69#Rotatable Bonds: 11Polar Surface Area: 138.76Molecular Species: ACIDHBA: 6HBD: 4#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.65CX Basic pKa: ┄CX LogP: 0.95CX LogD: -3.28Aromatic Rings: 2Heavy Atoms: 31QED Weighted: 0.39Np Likeness Score: -1.03
References 1. Dak M, Šlachtová V, Šebela M, Bazgier V, Berka K, Smiejkowska N, Oorts L, Cappoen D, Brulíková L.. (2022) Novel heterocyclic hydroxamates as inhibitors of the mycobacterial zinc metalloprotease Zmp1 to probe its mechanism of function., 244 [PMID:36242986 ] [10.1016/j.ejmech.2022.114831 ]