[3,5-bis(trifluoromethyl)phenyl]methyl 3-[[(2S)-2-[[2-(benzyloxycarbonylamino)acetyl]amino]-4-methyl-pentanoyl]amino]-1,2,4,9-tetrahydropyrido[2,3-b]indole-3-carboxylate

ID: ALA5271987

Max Phase: Preclinical

Molecular Formula: C37H37F6N5O6

Molecular Weight: 761.72

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(C)C[C@H](NC(=O)CNC(=O)OCc1ccccc1)C(=O)NC1(C(=O)OCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)CNc2[nH]c3ccccc3c2C1

Standard InChI:  InChI=1S/C37H37F6N5O6/c1-21(2)12-29(46-30(49)17-44-34(52)54-18-22-8-4-3-5-9-22)32(50)48-35(16-27-26-10-6-7-11-28(26)47-31(27)45-20-35)33(51)53-19-23-13-24(36(38,39)40)15-25(14-23)37(41,42)43/h3-11,13-15,21,29,45,47H,12,16-20H2,1-2H3,(H,44,52)(H,46,49)(H,48,50)/t29-,35?/m0/s1

Standard InChI Key:  PNPDRFDLRYVDNH-SZVSUXHCSA-N

Molfile:  

 
     RDKit          2D

 54 58  0  0  0  0  0  0  0  0999 V2000
    0.7276   -0.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4421   -0.3896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1565   -0.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1565   -1.6271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4421   -2.0396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7276   -1.6271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6136   -2.8465    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7695   -2.1791    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4340   -2.9328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5875   -2.0938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0727   -2.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7404   -3.5118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9211   -3.6029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4421    0.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7278    0.8474    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1795    0.8381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8705    0.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5903    0.8381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2814    0.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0012    0.8381    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6922    0.4350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6922   -0.3711    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.4120    0.0319    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.4120    0.8381    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.0012    1.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2814    2.0762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2814    2.8824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2814    3.6886    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.5903    3.2855    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.0012    3.2855    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.5903    1.6731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7278    0.0227    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0136   -0.3896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7005    0.0226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0136   -1.2144    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4148   -0.3896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7005    0.8474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4148    1.2597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4148    2.0844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1290    0.8474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4148   -1.2144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1290   -1.6267    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7005   -1.6267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1290   -2.4515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8432   -2.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8432   -3.6886    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5574   -2.4515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2717   -2.8639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9859   -2.4515    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7003   -2.8636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4120   -2.4519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4120   -1.6269    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7022   -1.2153    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9859   -1.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  4  3  1  0
  5  4  2  0
  1  6  1  0
  6  5  1  0
  5  7  1  0
  4  8  1  0
  8  9  2  0
  9  7  1  0
  8 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  9 13  1  0
  2 14  1  0
 14 15  2  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 21 24  1  0
 20 25  2  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 27 30  1  0
 26 31  2  0
 18 31  1  0
  2 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  2  0
 34 36  1  0
 34 37  1  1
 37 38  1  0
 38 39  1  0
 38 40  1  0
 36 41  1  0
 41 42  1  0
 41 43  2  0
 42 44  1  0
 44 45  1  0
 45 46  2  0
 45 47  1  0
 47 48  1  0
 48 49  1  0
 50 49  2  0
 51 50  1  0
 52 51  2  0
 53 52  1  0
 54 53  2  0
 49 54  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5271987

    ---

Associated Targets(Human)

TACR1 Tclin Neurokinin 1 receptor (6273 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 761.72Molecular Weight (Monoisotopic): 761.2648AlogP: 6.23#Rotatable Bonds: 12
Polar Surface Area: 150.65Molecular Species: NEUTRALHBA: 7HBD: 5
#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): 5#RO5 Violations (Lipinski): 3
CX Acidic pKa: 10.41CX Basic pKa: 1.29CX LogP: 6.04CX LogD: 6.04
Aromatic Rings: 4Heavy Atoms: 54QED Weighted: 0.08Np Likeness Score: -0.45

References

1. Van der Poorten O, Knuhtsen A, Sejer Pedersen D, Ballet S, Tourwé D..  (2016)  Side Chain Cyclized Aromatic Amino Acids: Great Tools as Local Constraints in Peptide and Peptidomimetic Design.,  59  (24): [PMID:27690430] [10.1021/acs.jmedchem.6b01029]

Source