((R)-4-((3R,5S,7R,8R,9S,10S,13R,14S,17R)-3-hydroxy-10,13-dimethyl-7-(nicotinoyloxy)hexadecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoyl)glycine

ID: ALA5272039

Max Phase: Preclinical

Molecular Formula: C32H46N2O6

Molecular Weight: 554.73

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@H](CCC(=O)NCC(=O)O)[C@H]1CC[C@H]2[C@@H]3[C@H](OC(=O)c4cccnc4)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C

Standard InChI:  InChI=1S/C32H46N2O6/c1-19(6-9-27(36)34-18-28(37)38)23-7-8-24-29-25(11-13-32(23,24)3)31(2)12-10-22(35)15-21(31)16-26(29)40-30(39)20-5-4-14-33-17-20/h4-5,14,17,19,21-26,29,35H,6-13,15-16,18H2,1-3H3,(H,34,36)(H,37,38)/t19-,21+,22-,23-,24+,25+,26-,29+,31+,32-/m1/s1

Standard InChI Key:  JTEZYTUOBQISDP-FAQAHJPFSA-N

Molfile:  

 
     RDKit          2D

 45 49  0  0  0  0  0  0  0  0999 V2000
   -2.9676   -1.2586    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9676   -0.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6818   -0.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3960   -0.4336    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3960    0.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6818    0.8033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9676    0.3910    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9675    1.2159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2534    0.8033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2534   -0.0215    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5391    0.3909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5391   -0.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2534   -0.8460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5391    1.2159    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8248    0.8033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7386   -0.0170    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8248    1.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5390    2.0405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2533    1.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7385    2.4485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0405    1.8829    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1729    2.6797    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4103    3.2630    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9698    2.8932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5531    2.3099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3500    2.5234    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9333    1.9400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7302    2.1536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3136    1.5702    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1104    1.7838    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5635    3.3202    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4442    1.2156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0406    0.5485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7706    2.0331    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1104   -0.8461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1001    0.7734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8246   -0.8461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8246   -1.6711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1102   -2.0836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5391   -2.0836    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6043   -1.6713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3162   -2.0832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3162   -2.9084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6061   -3.3202    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1102   -2.9121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1
  3  2  1  0
  4  3  1  0
  5  4  1  0
  5  6  1  0
  7  6  1  0
  2  7  1  0
  7  8  1  1
  7  9  1  0
  9 10  1  6
 11  9  1  0
 12 11  1  0
 13 12  1  0
  2 13  1  0
 11 14  1  1
 11 15  1  0
 15 16  1  6
 15 17  1  0
 17 18  1  0
 18 19  1  0
  9 19  1  0
 17 20  1  1
 17 21  1  0
 21 22  1  0
 22 23  1  6
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  2  0
 26 31  2  0
 21 32  1  0
 32 33  1  0
 15 33  1  0
 21 34  1  6
  4 35  1  6
 29 36  1  0
 12 37  1  6
 37 38  1  0
 38 39  1  0
 38 40  2  0
 41 39  2  0
 42 41  1  0
 43 42  2  0
 44 43  1  0
 45 44  2  0
 39 45  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5272039

    ---

Associated Targets(Human)

SLC10A2 Tclin Ileal bile acid transporter (415 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
SLC10A1 Tclin Bile acid transporter (197 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 554.73Molecular Weight (Monoisotopic): 554.3356AlogP: 4.85#Rotatable Bonds: 8
Polar Surface Area: 125.82Molecular Species: ACIDHBA: 6HBD: 3
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 3.89CX Basic pKa: 3.13CX LogP: 3.40CX LogD: 0.61
Aromatic Rings: 1Heavy Atoms: 40QED Weighted: 0.39Np Likeness Score: 1.39

References

1. Singla P, Salunke DB..  (2020)  Recent advances in steroid amino acid conjugates: Old scaffolds with new dimensions.,  187  [PMID:31830636] [10.1016/j.ejmech.2019.111909]

Source