ID: ALA5272406

Max Phase: Preclinical

Molecular Formula: C29H29FN3O3P

Molecular Weight: 517.54

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCn1cc(C(=O)O)c(=O)c2cc(F)c(N3CCN(CP(c4ccccc4)c4ccccc4)CC3)cc21

Standard InChI:  InChI=1S/C29H29FN3O3P/c1-2-32-19-24(29(35)36)28(34)23-17-25(30)27(18-26(23)32)33-15-13-31(14-16-33)20-37(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-12,17-19H,2,13-16,20H2,1H3,(H,35,36)

Standard InChI Key:  HJKBMRXOWJVJDR-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 41  0  0  0  0  0  0  0  0999 V2000
    0.7161    1.2383    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4307    1.6506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1426    1.2386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1426    0.4135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4324    0.0017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7161    0.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8572    1.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5719    1.2386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5719    0.4134    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8572    0.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8572    2.4764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2865    1.6512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2865    2.4764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0011    1.2386    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0015    1.6509    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0015   -0.0027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0015   -0.8279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7131   -1.2405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4277   -0.8279    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4277   -0.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7131    0.4098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1424   -1.2405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8570   -0.8279    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5716   -1.2405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8570   -0.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5715    0.4100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5708    1.2328    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8560    1.6455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1440    1.2362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1393    0.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5719   -2.0657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2847   -2.4764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9996   -2.0637    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0011   -1.2426    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2893   -0.8261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8572   -0.8242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5718   -1.2369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  1  6  1  0
  6  5  2  0
  3  7  1  0
  8  7  1  0
  9  8  2  0
 10  9  1  0
  4 10  1  0
  7 11  2  0
  8 12  1  0
 12 13  2  0
 12 14  1  0
  1 15  1  0
  6 16  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 21 20  1  0
 16 21  1  0
 19 22  1  0
 22 23  1  0
 23 24  1  0
 23 25  1  0
 26 25  2  0
 27 26  1  0
 28 27  2  0
 29 28  1  0
 30 29  2  0
 25 30  1  0
 31 24  2  0
 32 31  1  0
 33 32  2  0
 34 33  1  0
 35 34  2  0
 24 35  1  0
 10 36  1  0
 36 37  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5272406

    ---

Associated Targets(Human)

A549 (127892 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

CT26 (928 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 517.54Molecular Weight (Monoisotopic): 517.1931AlogP: 4.07#Rotatable Bonds: 7
Polar Surface Area: 65.78Molecular Species: ACIDHBA: 5HBD: 1
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 5.56CX Basic pKa: 7.32CX LogP: 3.65CX LogD: 3.46
Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.37Np Likeness Score: -0.78

References

1. Ahadi H, Emami S..  (2020)  Modification of 7-piperazinylquinolone antibacterials to promising anticancer lead compounds: Synthesis and in vitro studies.,  187  [PMID:31881454] [10.1016/j.ejmech.2019.111970]

Source