N-(5-(2-chlorophenyl)pyridin-3-yl)-2-(3,3-difluorocyclopentane-1-carboxamido)isonicotinamide

ID: ALA5272462

Max Phase: Preclinical

Molecular Formula: C23H19ClF2N4O2

Molecular Weight: 456.88

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1cncc(-c2ccccc2Cl)c1)c1ccnc(NC(=O)C2CCC(F)(F)C2)c1

Standard InChI:  InChI=1S/C23H19ClF2N4O2/c24-19-4-2-1-3-18(19)16-9-17(13-27-12-16)29-21(31)14-6-8-28-20(10-14)30-22(32)15-5-7-23(25,26)11-15/h1-4,6,8-10,12-13,15H,5,7,11H2,(H,29,31)(H,28,30,32)

Standard InChI Key:  OXEXOPRYGJGEFF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
   -1.0129   -3.1081    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7268   -2.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7268   -3.5213    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5515   -2.6948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8063   -1.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1392   -1.4259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1392   -0.6008    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8536   -0.1883    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8536    0.6365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1437    1.0482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1437    1.8732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4292    2.2857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7148    1.8732    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0003    2.2857    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7171    1.8714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4288    2.2878    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1432    1.8753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1432    1.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4288    0.6343    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.8597    0.6387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5698    1.0505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5698    1.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.2877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4288    3.1087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7125    3.5213    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0003    3.1108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4292    3.1107    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8554    2.2850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5698    1.8728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5698    1.0445    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4247   -0.1883    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4720   -1.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  7  6  1  0
  8  7  1  0
  9  8  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  2  0
 17 16  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 17  2  0
 16 24  1  0
 24 25  2  0
 25 26  1  0
 26 14  2  0
 12 27  2  0
 11 28  1  0
 28 29  2  0
 29 30  1  0
 30  9  2  0
  7 31  2  0
 32  6  1  0
 32  2  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5272462

    ---

Associated Targets(Human)

GSK3B Tclin Glycogen synthase kinase-3 beta (11785 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
MAPT Tclin Microtubule-associated protein tau (95507 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 456.88Molecular Weight (Monoisotopic): 456.1165AlogP: 5.42#Rotatable Bonds: 5
Polar Surface Area: 83.98Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.94CX Basic pKa: 3.86CX LogP: 3.87CX LogD: 3.87
Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.54Np Likeness Score: -1.38

References

1. Luo G, Chen L, Jacutin-Porte S, Han Y, Burton CR, Xiao H, Krause CM, Cao Y, Liu N, Kish K, Lewis HA, Macor JE, Dubowchik GM..  (2023)  Structure-activity relationship (SAR) studies on substituted N-(pyridin-3-yl)-2-amino-isonicotinamides as highly potent and selective glycogen synthase kinase-3 (GSK-3) inhibitors.,  81  [PMID:36669575] [10.1016/j.bmcl.2023.129143]

Source