N-ethyl-2-(4-hydroxy-1-(3-(2-methoxyphenoxy)benzyl)piperidin-4-yl)-4-methoxybenzenesulfonamide

ID: ALA5272687

Max Phase: Preclinical

Molecular Formula: C28H34N2O6S

Molecular Weight: 526.66

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCNS(=O)(=O)c1ccc(OC)cc1C1(O)CCN(Cc2cccc(Oc3ccccc3OC)c2)CC1

Standard InChI:  InChI=1S/C28H34N2O6S/c1-4-29-37(32,33)27-13-12-22(34-2)19-24(27)28(31)14-16-30(17-15-28)20-21-8-7-9-23(18-21)36-26-11-6-5-10-25(26)35-3/h5-13,18-19,29,31H,4,14-17,20H2,1-3H3

Standard InChI Key:  LQVDZKAJZHWQQE-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
   -3.9267    0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2121    1.2368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5002    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5002   -0.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2103   -0.4120    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9267   -0.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7856    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7856    2.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0709    2.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3563    2.0627    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3563    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0709    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5002    1.6501    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3582    2.4753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0729    2.0627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7877    2.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998    2.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4998    1.2377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7895    0.8257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0729    1.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    2.4757    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9291    2.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6439    2.4755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3559    2.0635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3559    1.2380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6456    0.8262    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9291    1.2343    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144    0.8218    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2144   -0.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7856   -0.4127    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7856   -1.2380    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6413    1.2371    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3559    0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0709   -1.6505    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0709   -2.4757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9588   -0.4127    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3722    0.3013    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  7  3  1  0
  7  8  1  0
  9  8  1  0
 10  9  1  0
 11 10  1  0
 12 11  1  0
  7 12  1  0
  7 13  1  0
 10 14  1  0
 14 15  1  0
 16 15  2  0
 17 16  1  0
 18 17  2  0
 19 18  1  0
 15 20  1  0
 20 19  2  0
 17 21  1  0
 21 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 22 27  1  0
 27 26  2  0
 27 28  1  0
 28 29  1  0
  4 30  1  0
 30 31  1  0
  1 32  1  0
 32 33  1  0
 31 34  1  0
 34 35  1  0
 30 36  2  0
 30 37  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5272687

    ---

Associated Targets(Human)

CCR8 Tchem C-C chemokine receptor type 8 (339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

COS-7 (515 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 526.66Molecular Weight (Monoisotopic): 526.2138AlogP: 4.28#Rotatable Bonds: 10
Polar Surface Area: 97.33Molecular Species: NEUTRALHBA: 7HBD: 2
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.16CX Basic pKa: 7.33CX LogP: 3.25CX LogD: 2.98
Aromatic Rings: 3Heavy Atoms: 37QED Weighted: 0.41Np Likeness Score: -0.87

References

1. Arimont M, Sun SL, Leurs R, Smit M, de Esch IJP, de Graaf C..  (2017)  Structural Analysis of Chemokine Receptor-Ligand Interactions.,  60  (12): [PMID:28165741] [10.1021/acs.jmedchem.6b01309]

Source