Quadrangularic acid M

ID: ALA5272789

Max Phase: Preclinical

Molecular Formula: C30H48O5

Molecular Weight: 488.71

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C=C(C)[C@H](O)CC[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CC[C@H]4[C@](C)(C(=O)O)[C@@H](O)C[C@H](O)[C@@]45C[C@@]35CC[C@]12C

Standard InChI:  InChI=1S/C30H48O5/c1-17(2)20(31)8-7-18(3)19-11-12-27(5)21-9-10-22-28(6,25(34)35)23(32)15-24(33)30(22)16-29(21,30)14-13-26(19,27)4/h18-24,31-33H,1,7-16H2,2-6H3,(H,34,35)/t18-,19-,20-,21+,22+,23+,24+,26-,27+,28+,29+,30-/m1/s1

Standard InChI Key:  ANUPVXRMSNOEBS-XJLZVQPFSA-N

Molfile:  

 
     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
   -3.0016    1.1081    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0016    0.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2874   -0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2874    0.6958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5731    0.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5731    1.1079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8587    1.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1444    1.1078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0530    1.9278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6593    1.3579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4709    1.5066    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8729    2.1548    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6698    2.3684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2532    1.7850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0501    1.9985    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2636    2.7954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6335    1.4151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4200    0.6182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4304    1.6287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2895    2.7382    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1299    0.7045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6381    0.0372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1444    0.2831    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0541   -0.5370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8587   -0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8587    0.6957    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8587   -0.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5731   -1.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2874   -0.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0018   -0.5415    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0016   -1.3664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5891   -2.0809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0016   -2.7954    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7641   -2.0809    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4141   -2.0809    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7159   -0.9540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4304   -1.3665    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7159   -0.1292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  6
  3  2  1  0
  3  4  1  1
  5  4  1  1
  3  5  1  0
  5  6  1  0
  7  6  1  0
  8  7  1  0
  8  9  1  1
  8 10  1  0
 10 11  1  6
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  1
 17 15  1  0
 17 18  1  0
 17 19  2  0
 12 20  1  6
 10 21  1  0
 22 21  1  0
 23 22  1  0
 23  8  1  0
 23 24  1  6
 25 23  1  0
 25  5  1  0
 25 26  1  1
 27 25  1  0
 28 27  1  0
 29 28  1  0
 29  3  1  0
 29 30  1  6
 31 29  1  0
 31 32  1  6
 32 33  1  0
 32 34  2  0
 31 35  1  0
 36 31  1  0
 36 37  1  1
 38 36  1  0
 38  2  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5272789

    ---

Associated Targets(non-human)

Hepatocyte (1455 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: YesOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 488.71Molecular Weight (Monoisotopic): 488.3502AlogP: 5.18#Rotatable Bonds: 6
Polar Surface Area: 97.99Molecular Species: ACIDHBA: 4HBD: 4
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 4#RO5 Violations (Lipinski): 1
CX Acidic pKa: 4.46CX Basic pKa: CX LogP: 4.26CX LogD: 1.42
Aromatic Rings: Heavy Atoms: 35QED Weighted: 0.39Np Likeness Score: 3.41

References

1. Xu GB, Xiao YH, Zhang QY, Zhou M, Liao SG..  (2018)  Hepatoprotective natural triterpenoids.,  145  [PMID:29353722] [10.1016/j.ejmech.2018.01.011]

Source