The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
((3R,5R,8S,9S,10S,13S,14S)-10,13-dimethylhexadecahydro-1H-cyclopenta[a]phenanthren-3-yl)carbamic acid ID: ALA5272953
Max Phase: Preclinical
Molecular Formula: C20H33NO2
Molecular Weight: 319.49
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C[C@@]12CCC[C@H]1[C@@H]1CC[C@@H]3C[C@H](NC(=O)O)CC[C@]3(C)[C@H]1CC2
Standard InChI: InChI=1S/C20H33NO2/c1-19-9-3-4-16(19)15-6-5-13-12-14(21-18(22)23)7-11-20(13,2)17(15)8-10-19/h13-17,21H,3-12H2,1-2H3,(H,22,23)/t13-,14-,15+,16+,17+,19+,20+/m1/s1
Standard InChI Key: YVYRUIIQLGMTAR-OEUDTILKSA-N
Molfile:
RDKit 2D
27 30 0 0 0 0 0 0 0 0999 V2000
2.9636 1.2579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1759 1.0128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4759 1.4170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7758 1.0129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7758 0.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0758 -0.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6241 0.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3241 -0.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3241 -1.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6241 -1.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0758 -1.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7758 -1.4120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4758 -1.0079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4758 -0.1996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1759 0.2045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9427 -0.0363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4247 0.6175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4758 0.6089 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
0.0758 -1.8164 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0243 -1.4120 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0758 0.6090 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7758 -0.6039 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.2654 1.8164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2643 -0.5991 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.7245 -1.0078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4247 -1.4120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7245 -0.1993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
2 3 1 0
3 4 1 0
5 4 1 0
6 5 1 0
6 7 1 0
8 7 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 6 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 5 1 0
14 15 1 0
15 2 1 0
15 16 1 0
16 17 1 0
1 17 1 0
14 18 1 1
11 19 1 1
9 20 1 6
6 21 1 1
5 22 1 6
2 23 1 1
15 24 1 6
20 25 1 0
25 26 1 0
25 27 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 319.49Molecular Weight (Monoisotopic): 319.2511AlogP: 5.06#Rotatable Bonds: 1Polar Surface Area: 49.33Molecular Species: ACIDHBA: 1HBD: 2#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.34CX Basic pKa: ┄CX LogP: 4.62CX LogD: 1.69Aromatic Rings: ┄Heavy Atoms: 23QED Weighted: 0.71Np Likeness Score: 2.10
References 1. Blanco MJ, La D, Coughlin Q, Newman CA, Griffin AM, Harrison BL, Salituro FG.. (2018) Breakthroughs in neuroactive steroid drug discovery., 28 (2): [PMID:29223589 ] [10.1016/j.bmcl.2017.11.043 ]