The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Corin ID: ALA5272967
Max Phase: Preclinical
Molecular Formula: C26H28N4O2
Molecular Weight: 428.54
Associated Items:
Names and Identifiers Canonical SMILES: Nc1ccccc1NC(=O)c1ccc(CCCC(=O)Nc2ccc([C@@H]3C[C@H]3N)cc2)cc1
Standard InChI: InChI=1S/C26H28N4O2/c27-22-5-1-2-6-24(22)30-26(32)19-10-8-17(9-11-19)4-3-7-25(31)29-20-14-12-18(13-15-20)21-16-23(21)28/h1-2,5-6,8-15,21,23H,3-4,7,16,27-28H2,(H,29,31)(H,30,32)/t21-,23+/m0/s1
Standard InChI Key: TYTLARZOLKJSJU-JTHBVZDNSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
-2.6267 -0.5072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0389 0.2074 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6274 0.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8001 0.9210 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3852 0.2072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7978 -0.5072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0398 1.6354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8646 1.6354 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6274 2.3497 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.2770 2.3497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1019 2.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5124 3.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0999 3.7770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2791 3.7786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8628 3.0671 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.5143 1.6357 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3853 -1.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5606 -1.2215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1481 -1.9358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6766 -1.9358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0890 -2.6501 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.0890 -1.2215 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9139 -2.6501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3265 -1.9359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1488 -1.9367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5614 -2.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1524 -3.3627 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3280 -3.3675 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3862 -2.6512 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1019 -3.0643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1010 -2.2395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5143 -3.7786 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
1 6 1 0
6 5 2 0
3 7 1 0
7 8 1 0
7 9 2 0
8 10 1 0
11 10 2 0
12 11 1 0
13 12 2 0
14 13 1 0
15 14 2 0
10 15 1 0
11 16 1 0
6 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
20 22 2 0
21 23 1 0
24 23 2 0
25 24 1 0
26 25 2 0
27 26 1 0
28 27 2 0
23 28 1 0
29 26 1 6
30 29 1 0
30 31 1 0
29 31 1 0
30 32 1 1
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 428.54Molecular Weight (Monoisotopic): 428.2212AlogP: 4.30#Rotatable Bonds: 8Polar Surface Area: 110.24Molecular Species: BASEHBA: 4HBD: 4#RO5 Violations: ┄HBA (Lipinski): 6HBD (Lipinski): 6#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 9.62CX LogP: 3.56CX LogD: 1.40Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.40Np Likeness Score: -0.73
References 1. Duan YC, Zhang SJ, Shi XJ, Jin LF, Yu T, Song Y, Guan YY.. (2021) Research progress of dual inhibitors targeting crosstalk between histone epigenetic modulators for cancer therapy., 222 [PMID:34107385 ] [10.1016/j.ejmech.2021.113588 ]