3-(4-((2-amino-6-methyl-4-oxo-3,4-dihydroquinazolin-5-yl)thio)benzamido)benzoic acid

ID: ALA5273148

Max Phase: Preclinical

Molecular Formula: C23H18N4O4S

Molecular Weight: 446.49

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  Cc1ccc2nc(N)[nH]c(=O)c2c1Sc1ccc(C(=O)Nc2cccc(C(=O)O)c2)cc1

Standard InChI:  InChI=1S/C23H18N4O4S/c1-12-5-10-17-18(21(29)27-23(24)26-17)19(12)32-16-8-6-13(7-9-16)20(28)25-15-4-2-3-14(11-15)22(30)31/h2-11H,1H3,(H,25,28)(H,30,31)(H3,24,26,27,29)

Standard InChI Key:  RUTNDZBOBDVEPC-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 32 35  0  0  0  0  0  0  0  0999 V2000
    2.1449   -2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1449   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8600   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5749   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5749   -2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8600   -2.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2899   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2899   -0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0050   -1.4437    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4299   -1.0312    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7150   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0000   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0000   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7150    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4299   -0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1450    0.2062    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1450    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4299    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7150    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4299    2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1450    2.6812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8600    2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8600    1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5749    1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5749    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2900    1.4437    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2900    2.2687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5749    2.6812    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0050    2.6812    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4299   -1.0312    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7150   -1.4437    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7150   -2.2687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  2  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  2  0
  7  4  1  0
  7  8  2  0
  7  9  1  0
 10  2  1  0
 11 10  1  0
 12 11  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 16 15  1  0
 17 16  1  0
 17 18  1  0
 18 19  1  0
 18 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 17  2  0
 23 24  1  0
 24 25  2  0
 26 24  1  0
 27 26  1  0
 28 27  2  0
 22 28  1  0
 27 29  1  0
 15 30  1  0
 30 31  2  0
 31 12  1  0
 11 32  2  0
M  END

Alternative Forms

  1. Parent:

    ALA5273148

    ---

Associated Targets(Human)

TYMS Tclin Thymidylate synthase (1651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 446.49Molecular Weight (Monoisotopic): 446.1049AlogP: 3.92#Rotatable Bonds: 5
Polar Surface Area: 138.17Molecular Species: ACIDHBA: 6HBD: 4
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski):
CX Acidic pKa: 3.92CX Basic pKa: 0.93CX LogP: 3.95CX LogD: 0.74
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.00

References

1. Alagarsamy V, Chitra K, Saravanan G, Solomon VR, Sulthana MT, Narendhar B..  (2018)  An overview of quinazolines: Pharmacological significance and recent developments.,  151  [PMID:29656203] [10.1016/j.ejmech.2018.03.076]

Source