The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-(3-(2-methoxyphenoxy)benzyl)piperidin-4-yl)-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxamide ID: ALA5273480
Max Phase: Preclinical
Molecular Formula: C29H31N3O4
Molecular Weight: 485.58
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccccc1Oc1cccc(CN2CCC(NC(=O)C3CC(=O)Nc4ccccc43)CC2)c1
Standard InChI: InChI=1S/C29H31N3O4/c1-35-26-11-4-5-12-27(26)36-22-8-6-7-20(17-22)19-32-15-13-21(14-16-32)30-29(34)24-18-28(33)31-25-10-3-2-9-23(24)25/h2-12,17,21,24H,13-16,18-19H2,1H3,(H,30,34)(H,31,33)
Standard InChI Key: UIOMNWOJKLSDKZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
-4.9976 0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2832 0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5686 0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5686 -0.4130 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2832 -0.8255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9976 -0.4130 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.8566 -0.8246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8564 -1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5663 -2.0618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2829 -1.6540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.7118 0.8243 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.8544 0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8544 1.6491 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1402 0.4119 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.4259 0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4259 1.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7116 2.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0025 1.6491 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0025 0.8243 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7116 0.4119 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7167 2.0614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4310 1.6491 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1454 2.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 1.6494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8571 0.8245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1472 0.4128 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4310 0.8208 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5714 2.0618 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.2857 1.6494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0001 2.0616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7118 1.6499 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7118 0.8248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0019 0.4131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2857 0.8211 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5714 0.4088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.5714 -0.4158 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
3 2 1 0
4 3 1 0
5 4 2 0
6 5 1 0
1 6 1 0
4 7 1 0
8 7 2 0
9 8 1 0
10 9 2 0
5 10 1 0
1 11 2 0
3 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
16 15 1 0
17 16 1 0
18 17 1 0
19 18 1 0
20 19 1 0
15 20 1 0
18 21 1 0
21 22 1 0
23 22 2 0
24 23 1 0
25 24 2 0
26 25 1 0
27 26 2 0
22 27 1 0
24 28 1 0
28 29 1 0
30 29 2 0
31 30 1 0
32 31 2 0
33 32 1 0
34 33 2 0
29 34 1 0
34 35 1 0
35 36 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 485.58Molecular Weight (Monoisotopic): 485.2315AlogP: 4.69#Rotatable Bonds: 7Polar Surface Area: 79.90Molecular Species: NEUTRALHBA: 5HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 13.70CX Basic pKa: 7.98CX LogP: 3.25CX LogD: 2.57Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.51Np Likeness Score: -0.97
References 1. Arimont M, Sun SL, Leurs R, Smit M, de Esch IJP, de Graaf C.. (2017) Structural Analysis of Chemokine Receptor-Ligand Interactions., 60 (12): [PMID:28165741 ] [10.1021/acs.jmedchem.6b01309 ]