N-(1-(3-(2-methoxyphenoxy)benzyl)piperidin-4-yl)-2-oxo-1,2,3,4-tetrahydroquinoline-4-carboxamide

ID: ALA5273480

Max Phase: Preclinical

Molecular Formula: C29H31N3O4

Molecular Weight: 485.58

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1Oc1cccc(CN2CCC(NC(=O)C3CC(=O)Nc4ccccc43)CC2)c1

Standard InChI:  InChI=1S/C29H31N3O4/c1-35-26-11-4-5-12-27(26)36-22-8-6-7-20(17-22)19-32-15-13-21(14-16-32)30-29(34)24-18-28(33)31-25-10-3-2-9-23(24)25/h2-12,17,21,24H,13-16,18-19H2,1H3,(H,30,34)(H,31,33)

Standard InChI Key:  UIOMNWOJKLSDKZ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 36 40  0  0  0  0  0  0  0  0999 V2000
   -4.9976    0.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2832    0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5686    0.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5686   -0.4130    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2832   -0.8255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9976   -0.4130    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8566   -0.8246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8564   -1.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5663   -2.0618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2829   -1.6540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7118    0.8243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8544    0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8544    1.6491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1402    0.4119    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4259    0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4259    1.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7116    2.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0025    1.6491    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0025    0.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7116    0.4119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7167    2.0614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4310    1.6491    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1454    2.0613    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8571    1.6494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8571    0.8245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1472    0.4128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4310    0.8208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5714    2.0618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2857    1.6494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0001    2.0616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7118    1.6499    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7118    0.8248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0019    0.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2857    0.8211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5714    0.4088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5714   -0.4158    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  3  2  1  0
  4  3  1  0
  5  4  2  0
  6  5  1  0
  1  6  1  0
  4  7  1  0
  8  7  2  0
  9  8  1  0
 10  9  2  0
  5 10  1  0
  1 11  2  0
  3 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 16 15  1  0
 17 16  1  0
 18 17  1  0
 19 18  1  0
 20 19  1  0
 15 20  1  0
 18 21  1  0
 21 22  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
 26 25  1  0
 27 26  2  0
 22 27  1  0
 24 28  1  0
 28 29  1  0
 30 29  2  0
 31 30  1  0
 32 31  2  0
 33 32  1  0
 34 33  2  0
 29 34  1  0
 34 35  1  0
 35 36  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5273480

    ---

Associated Targets(Human)

CCR8 Tchem C-C chemokine receptor type 8 (339 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

COS-7 (515 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 485.58Molecular Weight (Monoisotopic): 485.2315AlogP: 4.69#Rotatable Bonds: 7
Polar Surface Area: 79.90Molecular Species: NEUTRALHBA: 5HBD: 2
#RO5 Violations: HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 13.70CX Basic pKa: 7.98CX LogP: 3.25CX LogD: 2.57
Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.51Np Likeness Score: -0.97

References

1. Arimont M, Sun SL, Leurs R, Smit M, de Esch IJP, de Graaf C..  (2017)  Structural Analysis of Chemokine Receptor-Ligand Interactions.,  60  (12): [PMID:28165741] [10.1021/acs.jmedchem.6b01309]

Source