(2,3-dihydro-1H-inden-1-yl)(4-methoxy-4'-(trifluoromethoxy)-[1,1'-biphenyl]-3-yl)methanone

ID: ALA5273604

Max Phase: Preclinical

Molecular Formula: C24H19F3O3

Molecular Weight: 412.41

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  COc1ccc(-c2ccc(OC(F)(F)F)cc2)cc1C(=O)C1CCc2ccccc21

Standard InChI:  InChI=1S/C24H19F3O3/c1-29-22-13-9-17(15-6-10-18(11-7-15)30-24(25,26)27)14-21(22)23(28)20-12-8-16-4-2-3-5-19(16)20/h2-7,9-11,13-14,20H,8,12H2,1H3

Standard InChI Key:  AIZQSTZVLBDALQ-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 30 33  0  0  0  0  0  0  0  0999 V2000
    2.3497    2.1017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5620    1.8563    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2394    1.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4355    1.2299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2613    2.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9584    2.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1392    3.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9238    3.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5256    2.9036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4357    2.4137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4357    3.2186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1327    2.0112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1327    1.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8254    0.8046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8254   -0.0002    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5256   -0.4045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5256   -1.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8265   -1.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1291   -1.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1291   -0.4030    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8265   -2.4131    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1293   -2.8155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1293   -3.6204    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4323   -2.4131    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4323   -3.2180    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5243    1.2027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5243    2.0109    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8272    2.4131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8272    3.2180    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5243    3.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  4  3  1  0
  5  4  1  0
  6  5  1  0
  6  2  2  0
  6  7  1  0
  8  7  2  0
  9  8  1  0
  1  9  2  0
 10  5  1  0
 10 11  2  0
 12 10  1  0
 13 12  2  0
 14 13  1  0
 15 14  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 15  2  0
 18 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
 26 14  2  0
 27 26  1  0
 28 27  2  0
 12 28  1  0
 28 29  1  0
 29 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5273604

    ---

Associated Targets(Human)

PPIA Tclin Cyclophilin A (674 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PPIB Tchem Cyclophilin B (53 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.41Molecular Weight (Monoisotopic): 412.1286AlogP: 6.17#Rotatable Bonds: 5
Polar Surface Area: 35.53Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 6.88CX LogD: 6.88
Aromatic Rings: 3Heavy Atoms: 30QED Weighted: 0.47Np Likeness Score: -0.41

References

1. Dunyak BM, Gestwicki JE..  (2016)  Peptidyl-Proline Isomerases (PPIases): Targets for Natural Products and Natural Product-Inspired Compounds.,  59  (21): [PMID:27409354] [10.1021/acs.jmedchem.6b00411]

Source