2-ethyl-8-methyl-5-(2-(trifluoromethyl)imidazo[1,2-a]pyridin-3-yl)-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole

ID: ALA5273633

Max Phase: Preclinical

Molecular Formula: C22H21F3N4

Molecular Weight: 398.43

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN1CCc2c(c3cc(C)ccc3n2-c2c(C(F)(F)F)nc3ccccn23)C1

Standard InChI:  InChI=1S/C22H21F3N4/c1-3-27-11-9-18-16(13-27)15-12-14(2)7-8-17(15)29(18)21-20(22(23,24)25)26-19-6-4-5-10-28(19)21/h4-8,10,12H,3,9,11,13H2,1-2H3

Standard InChI Key:  JPPUZWHATVFVHO-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 29 33  0  0  0  0  0  0  0  0999 V2000
   -1.2391   -0.5053    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9559   -0.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9559    0.7319    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2409    1.1445    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5285    0.7323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5285   -0.0933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2567   -0.3484    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7420    0.3194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2567    0.9874    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5920    1.7393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4134    1.8257    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8977    1.1621    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5666    0.4062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4703   -1.1460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2408   -1.4418    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1977   -2.2660    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4004   -2.4796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0489   -1.7874    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0264   -3.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7979   -3.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2467   -2.5682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8767   -1.8310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9559   -1.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9559   -0.2032    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6711   -1.4418    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    2.6711   -0.6160    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.8263    2.5409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4134    3.2560    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6711    1.1448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  8  7  1  0
  9  8  2  0
  5  9  1  0
  9 10  1  0
 11 10  1  0
 12 11  1  0
 13 12  1  0
  8 13  1  0
  7 14  1  0
 15 14  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 14  1  0
 17 19  1  0
 20 19  2  0
 21 20  1  0
 22 21  2  0
 18 22  1  0
 15 23  1  0
 23 24  1  0
 23 25  1  0
 23 26  1  0
 11 27  1  0
 27 28  1  0
  3 29  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5273633

    ---

Associated Targets(Human)

GRIN2B Tclin Glutamate [NMDA] receptor subunit epsilon 2 (467 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 398.43Molecular Weight (Monoisotopic): 398.1718AlogP: 4.98#Rotatable Bonds: 2
Polar Surface Area: 25.47Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 7.17CX LogP: 4.64CX LogD: 4.44
Aromatic Rings: 4Heavy Atoms: 29QED Weighted: 0.48Np Likeness Score: -1.58

References

1. Dai J, Dan W, Zhang Y, Wang J..  (2018)  Recent developments on synthesis and biological activities of γ-carboline.,  157  [PMID:30103193] [10.1016/j.ejmech.2018.08.015]

Source