The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-(2-(7-(diethylamino)-2-oxo-2H-chromen-3-yl)-1H-benzo[d]imidazol-5-yl)-3,4,5,6-tetrahydropyrimidin-1-ium chloride ID: ALA5273678
Max Phase: Preclinical
Molecular Formula: C24H26ClN5O2
Molecular Weight: 415.50
Associated Items:
Names and Identifiers Canonical SMILES: CCN(CC)c1ccc2cc(-c3nc4cc(C5=NCCCN5)ccc4[nH]3)c(=O)oc2c1.Cl
Standard InChI: InChI=1S/C24H25N5O2.ClH/c1-3-29(4-2)17-8-6-15-12-18(24(30)31-21(15)14-17)23-27-19-9-7-16(13-20(19)28-23)22-25-10-5-11-26-22;/h6-9,12-14H,3-5,10-11H2,1-2H3,(H,25,26)(H,27,28);1H
Standard InChI Key: QDCMGWUZNQPGQU-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
3.0022 -2.7363 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.3532 -1.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7655 -0.8658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.5900 -0.8658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0023 -1.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5900 -2.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7655 -2.2950 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5286 -1.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1163 -0.8658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2918 -0.8658 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8795 -1.5804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0824 -1.4155 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0274 -0.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7420 -0.2611 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7421 -0.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7421 0.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4567 1.0581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.1713 0.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8859 1.0581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5730 0.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5730 -0.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8859 -0.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1713 -0.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4567 -0.5909 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2877 1.0581 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.0023 0.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.0023 -0.1786 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2877 1.8827 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5730 2.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0274 1.0581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2918 -2.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1163 -2.2950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
2 8 1 0
9 8 1 0
9 10 2 0
11 10 1 0
12 11 1 0
13 12 1 0
10 14 1 0
13 14 2 0
13 15 1 0
16 15 1 0
16 17 1 0
18 17 1 0
19 18 1 0
20 19 2 0
21 20 1 0
22 21 2 0
23 22 1 0
23 18 2 0
15 24 2 0
24 23 1 0
20 25 1 0
25 26 1 0
26 27 1 0
25 28 1 0
28 29 1 0
16 30 2 0
31 11 2 0
8 32 2 0
32 31 1 0
6 7 1 0
2 7 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 415.50Molecular Weight (Monoisotopic): 415.2008AlogP: 3.92#Rotatable Bonds: 5Polar Surface Area: 86.52Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 9.48CX Basic pKa: 8.69CX LogP: 2.49CX LogD: 1.27Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.48Np Likeness Score: -0.77
References 1. Beč A, Racané L, Žonja L, Persoons L, Daelemans D, Starčević K, Vianello R, Hranjec M.. (2023) Biological evaluation of novel amidino substituted coumarin-benzazole hybrids as promising therapeutic agents., 14 (5): [PMID:37252100 ] [10.1039/d3md00055a ]