1-(9H-carbazol-9-yl)-3-(2-ethyl-8-methyl-1,2,3,4-tetrahydro-5H-pyrido[4,3-b]indol-5-yl)propan-2-ol

ID: ALA5273904

Max Phase: Preclinical

Molecular Formula: C29H31N3O

Molecular Weight: 437.59

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCN1CCc2c(c3cc(C)ccc3n2CC(O)Cn2c3ccccc3c3ccccc32)C1

Standard InChI:  InChI=1S/C29H31N3O/c1-3-30-15-14-29-25(19-30)24-16-20(2)12-13-28(24)32(29)18-21(33)17-31-26-10-6-4-8-22(26)23-9-5-7-11-27(23)31/h4-13,16,21,33H,3,14-15,17-19H2,1-2H3

Standard InChI Key:  RYUQBOMKRRQWAF-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 33 38  0  0  0  0  0  0  0  0999 V2000
   -0.3025    1.9879    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0193    2.3963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0193    3.2252    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3043    3.6378    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4079    3.2256    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4079    2.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1930    2.1448    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6785    2.8128    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1932    3.4807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5285    4.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3498    4.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8341    3.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5031    2.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4068    1.3473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8230    0.7634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0367   -0.0341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0254    0.9771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4527   -0.6179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.5819   -1.4330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1534   -1.8078    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7369   -1.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3622   -0.4888    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5586   -1.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0084   -0.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6372    0.1580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8138    0.2061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2717   -1.8816    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2287   -2.7060    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4979   -3.0804    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1965   -2.6354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8341   -0.5744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4979   -3.9062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2130   -4.3190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  6  7  1  0
  8  7  1  0
  9  8  2  0
  5  9  1  0
  9 10  1  0
 11 10  2  0
 12 11  1  0
 13 12  2  0
  8 13  1  0
  7 14  1  0
 14 15  1  0
 15 16  1  0
 15 17  1  0
 16 18  1  0
 19 18  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 18  1  0
 21 23  1  0
 24 23  2  0
 25 24  1  0
 26 25  2  0
 22 26  1  0
 19 27  1  0
 28 27  1  0
 29 28  1  0
 30 29  1  0
 20 30  1  0
 24 31  1  0
 29 32  1  0
 32 33  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5273904

    ---

Associated Targets(Human)

GRIN1 Tclin Glutamate [NMDA] receptor (933 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 437.59Molecular Weight (Monoisotopic): 437.2467AlogP: 5.50#Rotatable Bonds: 5
Polar Surface Area: 33.33Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 7.34CX LogP: 5.35CX LogD: 5.08
Aromatic Rings: 5Heavy Atoms: 33QED Weighted: 0.39Np Likeness Score: -0.72

References

1. Dai J, Dan W, Zhang Y, Wang J..  (2018)  Recent developments on synthesis and biological activities of γ-carboline.,  157  [PMID:30103193] [10.1016/j.ejmech.2018.08.015]

Source