The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-benzyl-6-(furan-2-ylmethyl)-7-(furan-3-yl)-3-morpholino-6,7-dihydro-5H-pyrrolo[3,4-b]pyridin-5-one ID: ALA5274023
Max Phase: Preclinical
Molecular Formula: C27H25N3O4
Molecular Weight: 455.51
Associated Items:
Names and Identifiers Canonical SMILES: O=C1c2cc(N3CCOCC3)c(Cc3ccccc3)nc2C(c2ccoc2)N1Cc1ccco1
Standard InChI: InChI=1S/C27H25N3O4/c31-27-22-16-24(29-9-13-32-14-10-29)23(15-19-5-2-1-3-6-19)28-25(22)26(20-8-12-33-18-20)30(27)17-21-7-4-11-34-21/h1-8,11-12,16,18,26H,9-10,13-15,17H2
Standard InChI Key: BHUNDTOUHWJGPX-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
0.6778 -0.2105 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3924 0.2017 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3895 1.0299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6760 1.4380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0350 0.2012 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0337 1.0278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8196 1.2846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3066 0.6165 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.8216 -0.0530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0773 -0.8398 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8602 -1.0929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8614 -1.9157 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0792 -2.1711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.5947 -1.5061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.1294 0.6176 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5397 1.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2022 2.0830 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8128 2.6345 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5260 2.2240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 1.4190 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0726 2.0675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1020 1.4416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8159 1.0307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5248 1.4413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5260 2.2645 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8120 2.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0969 2.2631 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1056 -0.2085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1069 -1.0313 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3937 -1.4422 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3946 -2.2643 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1084 -2.6754 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8226 -2.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8182 -1.4378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
5 1 1 0
4 6 1 0
5 6 2 0
6 7 1 0
7 8 1 0
8 9 1 0
9 5 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 1 0
13 14 2 0
14 10 1 0
8 15 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 16 1 0
7 21 2 0
3 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
22 27 1 0
26 27 1 0
2 28 1 0
28 29 1 0
29 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 29 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.51Molecular Weight (Monoisotopic): 455.1845AlogP: 4.44#Rotatable Bonds: 6Polar Surface Area: 71.95Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: 12.35CX Basic pKa: 2.35CX LogP: 3.60CX LogD: 3.60Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.43Np Likeness Score: -0.77
References 1. Morales-Salazar I, Montes-Enríquez FP, Garduño-Albino CE, García-Sánchez MA, Ibarra IA, Rojas-Aguirre Y, García-Hernández ME, Sarmiento-Silva RE, Alcaraz-Estrada SL, Díaz-Cervantes E, González-Zamora E, Islas-Jácome A.. (2023) Synthesis of bis-furyl-pyrrolo[3,4-b ]pyridin-5-ones via Ugi-Zhu reaction and in vitro activity assays against human SARS-CoV-2 and in silico studies on its main proteins., 14 (1.0): [PMID:36760742 ] [10.1039/d2md00350c ]