The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Cis-(4R)-N-[(1S)-2-[(2-amino-2-oxo-ethyl)amino]-1-(1H-indol-3-ylmethyl)-2-oxo-ethyl]-3-[(2S)-2-[[(2S)-2-amino-3-phenyl-propanoyl]amino]-3-phenyl-propanoyl]-2,2-dimethyl-thiazolidine-4-carboxamide ID: ALA5274193
Max Phase: Preclinical
Molecular Formula: C37H43N7O5S
Molecular Weight: 697.86
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1(C)SC[C@@H](C(=O)N[C@@H](Cc2c[nH]c3ccccc23)C(=O)NCC(N)=O)N1C(=O)[C@H](Cc1ccccc1)NC(=O)[C@@H](N)Cc1ccccc1
Standard InChI: InChI=1S/C37H43N7O5S/c1-37(2)44(36(49)30(18-24-13-7-4-8-14-24)43-33(46)27(38)17-23-11-5-3-6-12-23)31(22-50-37)35(48)42-29(34(47)41-21-32(39)45)19-25-20-40-28-16-10-9-15-26(25)28/h3-16,20,27,29-31,40H,17-19,21-22,38H2,1-2H3,(H2,39,45)(H,41,47)(H,42,48)(H,43,46)/t27-,29-,30-,31-/m0/s1
Standard InChI Key: CSLJVJOUANNCSL-QBCKSJLUSA-N
Molfile:
RDKit 2D
50 54 0 0 0 0 0 0 0 0999 V2000
-0.8259 -2.1089 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.0009 -2.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2492 -2.9129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4043 -3.3837 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-1.0718 -2.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4114 -1.3947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0009 -0.6804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2362 -1.3947 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6487 -0.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4734 -0.6804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2362 0.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6487 0.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2362 1.4624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8073 2.0809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5415 1.7502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.4492 0.9266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4178 1.6477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1674 2.4516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7342 3.0682 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5560 2.8880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8858 0.0339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.8858 -1.3947 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.7107 0.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1230 0.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9478 0.7481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.7107 1.4624 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8981 -2.8917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4850 -3.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2383 -1.3947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7145 -1.3916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5388 -1.3963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9478 -2.1079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7130 -2.8232 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5352 -2.8224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3003 -2.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4754 -2.1089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0631 -1.3947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4754 -0.6804 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.0614 2.8941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4775 3.6056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2984 3.6040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3004 2.1770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7109 2.8895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4754 2.1768 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0631 1.4624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3003 0.7481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2383 0.0339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.4754 0.7481 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0631 0.0339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8259 -0.6804 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
5 4 1 0
1 5 1 0
2 6 1 6
6 7 2 0
6 8 1 0
9 8 1 1
9 10 1 0
9 11 1 0
11 12 1 0
13 12 1 0
13 14 2 0
14 15 1 0
12 16 2 0
16 15 1 0
13 17 1 0
18 17 2 0
19 18 1 0
14 20 1 0
20 19 2 0
10 21 1 0
10 22 2 0
21 23 1 0
23 24 1 0
24 25 1 0
24 26 2 0
5 27 1 0
5 28 1 0
1 29 1 0
30 31 2 0
31 32 1 0
34 33 1 0
32 34 2 0
35 33 2 0
35 30 1 0
35 36 1 0
29 37 1 0
36 37 1 0
37 38 1 6
39 40 2 0
40 41 1 0
43 42 1 0
41 43 2 0
44 42 2 0
39 44 1 0
44 45 1 0
48 46 1 1
45 48 1 0
38 49 1 0
49 47 2 0
48 49 1 0
29 50 2 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 697.86Molecular Weight (Monoisotopic): 697.3046AlogP: 1.77#Rotatable Bonds: 14Polar Surface Area: 192.51Molecular Species: NEUTRALHBA: 7HBD: 6#RO5 Violations: 2HBA (Lipinski): 12HBD (Lipinski): 8#RO5 Violations (Lipinski): 3CX Acidic pKa: 12.03CX Basic pKa: 7.71CX LogP: 1.73CX LogD: 1.25Aromatic Rings: 4Heavy Atoms: 50QED Weighted: 0.12Np Likeness Score: -0.17