The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-((2-chloro-N-(4-(thiophen-2-yl)thiazol-2-yl)benzamido)methyl)phenyl)sulfamic acid ID: ALA5274277
Max Phase: Preclinical
Molecular Formula: C21H16ClN3O4S3
Molecular Weight: 506.03
Associated Items:
Names and Identifiers Canonical SMILES: O=C(c1ccccc1Cl)N(Cc1ccc(NS(=O)(=O)O)cc1)c1nc(-c2cccs2)cs1
Standard InChI: InChI=1S/C21H16ClN3O4S3/c22-17-5-2-1-4-16(17)20(26)25(21-23-18(13-31-21)19-6-3-11-30-19)12-14-7-9-15(10-8-14)24-32(27,28)29/h1-11,13,24H,12H2,(H,27,28,29)
Standard InChI Key: TZWDMFVVLHCGQJ-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 35 0 0 0 0 0 0 0 0999 V2000
1.8479 1.8833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1297 1.4772 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4190 1.8961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2991 1.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3065 0.6650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0247 0.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7354 0.6778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4536 0.2716 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.1644 0.6905 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-3.1570 1.5155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.7281 1.5027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0099 1.9088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1224 0.6522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9897 0.6905 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3780 -0.1066 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.5626 1.4707 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8333 0.2332 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.6405 -0.5866 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8383 -0.6603 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5129 0.1025 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4257 -1.3750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2775 1.8831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9897 1.4710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9897 0.6455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2793 0.2336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5626 0.6418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8479 2.7085 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2775 2.7084 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.8383 -2.0897 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.2669 -2.7085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4676 -2.3778 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.3753 -1.5536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
7 6 1 0
7 8 1 0
9 8 1 0
9 10 1 0
7 11 2 0
11 12 1 0
12 4 2 0
13 2 1 0
9 14 2 0
9 15 2 0
1 16 1 0
17 13 1 0
17 18 1 0
18 19 2 0
20 19 1 0
13 20 2 0
19 21 1 0
22 16 2 0
23 22 1 0
24 23 2 0
25 24 1 0
26 25 2 0
16 26 1 0
1 27 2 0
22 28 1 0
29 21 1 0
29 30 1 0
30 31 2 0
32 31 1 0
21 32 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 506.03Molecular Weight (Monoisotopic): 504.9991AlogP: 5.59#Rotatable Bonds: 7Polar Surface Area: 99.60Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: -1.90CX Basic pKa: ┄CX LogP: 3.33CX LogD: 2.53Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.32Np Likeness Score: -2.13
References 1. Zhang W, Wei Z, Huang G, Xie F, Zheng Z, Li S.. (2020) Study of triaryl-based sulfamic acid derivatives as HPTPβ inhibitors., 28 (23.0): [PMID:32992253 ] [10.1016/j.bmc.2020.115777 ]