The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(R)-3-(1,3-dimethyl-1H-pyrazolo[4,3-e][1,2,4]triazin-5-yl)-4-ethoxy-N-(1-hydroxy-4-methylpentan-2-yl)benzenesulfonamide ID: ALA5274281
Max Phase: Preclinical
Molecular Formula: C20H28N6O4S
Molecular Weight: 448.55
Associated Items:
Names and Identifiers Canonical SMILES: CCOc1ccc(S(=O)(=O)N[C@@H](CO)CC(C)C)cc1-c1nnc2c(n1)c(C)nn2C
Standard InChI: InChI=1S/C20H28N6O4S/c1-6-30-17-8-7-15(31(28,29)25-14(11-27)9-12(2)3)10-16(17)19-21-18-13(4)24-26(5)20(18)23-22-19/h7-8,10,12,14,25,27H,6,9,11H2,1-5H3/t14-/m1/s1
Standard InChI Key: QPMGWKYXVMQQCM-CQSZACIVSA-N
Molfile:
RDKit 2D
31 33 0 0 0 0 0 0 0 0999 V2000
-0.0789 1.0310 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6355 1.4433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3474 1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3474 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6374 -0.2055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0789 0.2025 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6374 -1.0307 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.3519 -1.4433 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3519 -2.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0666 -2.6810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2247 -1.7453 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.1878 -1.0307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.6355 2.2685 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3502 2.6811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3502 3.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7936 1.4436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5084 1.0311 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.2205 1.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2205 2.2686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5102 2.6805 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.7936 2.2723 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0037 2.5146 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4959 1.8468 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.0250 1.1929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2385 0.3958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2172 3.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6374 -2.6810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6374 -3.5063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.7813 -2.2685 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4959 -2.6810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7813 -1.4433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 1 0
4 3 2 0
5 4 1 0
6 5 2 0
1 6 1 0
5 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
7 11 2 0
7 12 2 0
2 13 1 0
13 14 1 0
14 15 1 0
16 1 1 0
17 16 2 0
18 17 1 0
19 18 2 0
20 19 1 0
21 20 2 0
16 21 1 0
19 22 1 0
22 23 1 0
24 23 2 0
18 24 1 0
24 25 1 0
22 26 1 0
9 27 1 6
27 28 1 0
10 29 1 0
29 30 1 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 448.55Molecular Weight (Monoisotopic): 448.1893AlogP: 1.82#Rotatable Bonds: 9Polar Surface Area: 132.12Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.19CX Basic pKa: 1.01CX LogP: 1.64CX LogD: 1.64Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -1.54
References 1. Alizadeh SR, Ebrahimzadeh MA.. (2021) Pyrazolotriazines: Biological activities, synthetic strategies and recent developments., 223 [PMID:34147747 ] [10.1016/j.ejmech.2021.113537 ]