(R)-3-(1,3-dimethyl-1H-pyrazolo[4,3-e][1,2,4]triazin-5-yl)-4-ethoxy-N-(1-hydroxy-4-methylpentan-2-yl)benzenesulfonamide

ID: ALA5274281

Max Phase: Preclinical

Molecular Formula: C20H28N6O4S

Molecular Weight: 448.55

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCOc1ccc(S(=O)(=O)N[C@@H](CO)CC(C)C)cc1-c1nnc2c(n1)c(C)nn2C

Standard InChI:  InChI=1S/C20H28N6O4S/c1-6-30-17-8-7-15(31(28,29)25-14(11-27)9-12(2)3)10-16(17)19-21-18-13(4)24-26(5)20(18)23-22-19/h7-8,10,12,14,25,27H,6,9,11H2,1-5H3/t14-/m1/s1

Standard InChI Key:  QPMGWKYXVMQQCM-CQSZACIVSA-N

Molfile:  

 
     RDKit          2D

 31 33  0  0  0  0  0  0  0  0999 V2000
   -0.0789    1.0310    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6355    1.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3474    1.0314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3474    0.2062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6374   -0.2055    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0789    0.2025    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6374   -1.0307    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.3519   -1.4433    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3519   -2.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0666   -2.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2247   -1.7453    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1878   -1.0307    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6355    2.2685    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3502    2.6811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3502    3.5063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7936    1.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5084    1.0311    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2205    1.4432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2205    2.2686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5102    2.6805    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7936    2.2723    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0037    2.5146    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4959    1.8468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0250    1.1929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2385    0.3958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2172    3.3117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6374   -2.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6374   -3.5063    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7813   -2.2685    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4959   -2.6810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7813   -1.4433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  2  1  0
  4  3  2  0
  5  4  1  0
  6  5  2  0
  1  6  1  0
  5  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  7 11  2  0
  7 12  2  0
  2 13  1  0
 13 14  1  0
 14 15  1  0
 16  1  1  0
 17 16  2  0
 18 17  1  0
 19 18  2  0
 20 19  1  0
 21 20  2  0
 16 21  1  0
 19 22  1  0
 22 23  1  0
 24 23  2  0
 18 24  1  0
 24 25  1  0
 22 26  1  0
  9 27  1  6
 27 28  1  0
 10 29  1  0
 29 30  1  0
 29 31  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5274281

    ---

Associated Targets(Human)

TYR Tclin Tyrosinase (717 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 448.55Molecular Weight (Monoisotopic): 448.1893AlogP: 1.82#Rotatable Bonds: 9
Polar Surface Area: 132.12Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 10.19CX Basic pKa: 1.01CX LogP: 1.64CX LogD: 1.64
Aromatic Rings: 3Heavy Atoms: 31QED Weighted: 0.51Np Likeness Score: -1.54

References

1. Alizadeh SR, Ebrahimzadeh MA..  (2021)  Pyrazolotriazines: Biological activities, synthetic strategies and recent developments.,  223  [PMID:34147747] [10.1016/j.ejmech.2021.113537]

Source