The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Isomalyngamides A ID: ALA5274310
Max Phase: Preclinical
Molecular Formula: C30H47ClN2O6
Molecular Weight: 567.17
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCC[C@@H](C/C=C/CCC(=O)N(C)C/C(=C\Cl)C/C(=C\C(=O)N1CC(OC)=CC1=O)OC)OC
Standard InChI: InChI=1S/C30H47ClN2O6/c1-6-7-8-9-10-12-15-25(37-3)16-13-11-14-17-28(34)32(2)22-24(21-31)18-26(38-4)19-29(35)33-23-27(39-5)20-30(33)36/h11,13,19-21,25H,6-10,12,14-18,22-23H2,1-5H3/b13-11+,24-21-,26-19+/t25-/m0/s1
Standard InChI Key: KYTKWBZOTKUPBI-GLRGBWIBSA-N
Molfile:
RDKit 2D
39 39 0 0 0 0 0 0 0 0999 V2000
7.2988 2.6714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8821 2.0881 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.6686 1.2911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1392 0.6376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6474 -0.0297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8608 -0.8266 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.8646 0.2160 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.8646 1.0410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1501 -0.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4356 0.2160 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1501 -1.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4356 -1.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4356 -2.2589 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1501 -2.6714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7211 -1.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0067 -1.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0067 -2.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2922 -2.6714 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.2922 -1.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5777 -1.4339 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5777 -2.2589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8632 -1.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8632 -0.1963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1487 -1.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4342 -1.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2801 -1.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9946 -1.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7091 -1.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4236 -1.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4236 -0.1963 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.1381 0.2160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.1381 -1.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8526 -1.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5671 -1.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2815 -1.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9960 -1.4339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.7105 -1.0214 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.4247 -1.4337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.1392 -1.0213 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
3 4 2 0
5 4 1 0
5 6 2 0
7 5 1 0
8 7 1 0
8 3 1 0
9 7 1 0
9 10 2 0
11 9 1 0
12 11 2 0
12 13 1 0
13 14 1 0
15 12 1 0
16 15 1 0
16 17 2 0
17 18 1 0
19 16 1 0
20 19 1 0
20 21 1 0
22 20 1 0
22 23 2 0
24 22 1 0
25 24 1 0
26 25 1 0
27 26 2 0
28 27 1 0
29 28 1 0
29 30 1 6
30 31 1 0
32 29 1 0
33 32 1 0
34 33 1 0
35 34 1 0
36 35 1 0
37 36 1 0
38 37 1 0
38 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Topical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 567.17Molecular Weight (Monoisotopic): 566.3123AlogP: 5.88#Rotatable Bonds: 20Polar Surface Area: 85.38Molecular Species: NEUTRALHBA: 6HBD: ┄#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.32CX Basic pKa: ┄CX LogP: 4.16CX LogD: 4.16Aromatic Rings: ┄Heavy Atoms: 39QED Weighted: 0.08Np Likeness Score: 1.28
References 1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L.. (2020) Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species., 201 [PMID:32652435 ] [10.1016/j.ejmech.2020.112473 ]