Isomalyngamides A

ID: ALA5274310

Max Phase: Preclinical

Molecular Formula: C30H47ClN2O6

Molecular Weight: 567.17

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCCCCC[C@@H](C/C=C/CCC(=O)N(C)C/C(=C\Cl)C/C(=C\C(=O)N1CC(OC)=CC1=O)OC)OC

Standard InChI:  InChI=1S/C30H47ClN2O6/c1-6-7-8-9-10-12-15-25(37-3)16-13-11-14-17-28(34)32(2)22-24(21-31)18-26(38-4)19-29(35)33-23-27(39-5)20-30(33)36/h11,13,19-21,25H,6-10,12,14-18,22-23H2,1-5H3/b13-11+,24-21-,26-19+/t25-/m0/s1

Standard InChI Key:  KYTKWBZOTKUPBI-GLRGBWIBSA-N

Molfile:  

 
     RDKit          2D

 39 39  0  0  0  0  0  0  0  0999 V2000
    7.2988    2.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8821    2.0881    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.6686    1.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1392    0.6376    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6474   -0.0297    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8608   -0.8266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8646    0.2160    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.8646    1.0410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1501   -0.1963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4356    0.2160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1501   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4356   -1.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4356   -2.2589    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1501   -2.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7211   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0067   -1.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0067   -2.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2922   -2.6714    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.2922   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5777   -1.4339    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5777   -2.2589    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8632   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8632   -0.1963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1487   -1.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4342   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2801   -1.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9946   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7091   -1.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4236   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4236   -0.1963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1381    0.2160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1381   -1.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8526   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5671   -1.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2815   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9960   -1.4339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7105   -1.0214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4247   -1.4337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1392   -1.0213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  3  4  2  0
  5  4  1  0
  5  6  2  0
  7  5  1  0
  8  7  1  0
  8  3  1  0
  9  7  1  0
  9 10  2  0
 11  9  1  0
 12 11  2  0
 12 13  1  0
 13 14  1  0
 15 12  1  0
 16 15  1  0
 16 17  2  0
 17 18  1  0
 19 16  1  0
 20 19  1  0
 20 21  1  0
 22 20  1  0
 22 23  2  0
 24 22  1  0
 25 24  1  0
 26 25  1  0
 27 26  2  0
 28 27  1  0
 29 28  1  0
 29 30  1  6
 30 31  1  0
 32 29  1  0
 33 32  1  0
 34 33  1  0
 35 34  1  0
 36 35  1  0
 37 36  1  0
 38 37  1  0
 38 39  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5274310

    ---

Associated Targets(non-human)

L1210 (27553 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 567.17Molecular Weight (Monoisotopic): 566.3123AlogP: 5.88#Rotatable Bonds: 20
Polar Surface Area: 85.38Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski): 2
CX Acidic pKa: 9.32CX Basic pKa: CX LogP: 4.16CX LogD: 4.16
Aromatic Rings: Heavy Atoms: 39QED Weighted: 0.08Np Likeness Score: 1.28

References

1. Xu J, Zhang T, Yao J, Lu J, Liu Z, Ding L..  (2020)  Recent advances in chemistry and bioactivity of marine cyanobacteria Moorea species.,  201  [PMID:32652435] [10.1016/j.ejmech.2020.112473]

Source