rac-6-(2-Amino-1-phenylethyl)-3-(pyridin-3-yl)-5,6-dihydrothieno[2,3-c]pyridin-7(4H)-one

ID: ALA5274333

Max Phase: Preclinical

Molecular Formula: C20H19N3OS

Molecular Weight: 349.46

Associated Items:

Names and Identifiers

Canonical SMILES:  NCC(c1ccccc1)N1CCc2c(-c3cccnc3)csc2C1=O

Standard InChI:  InChI=1S/C20H19N3OS/c21-11-18(14-5-2-1-3-6-14)23-10-8-16-17(13-25-19(16)20(23)24)15-7-4-9-22-12-15/h1-7,9,12-13,18H,8,10-11,21H2

Standard InChI Key:  XFQSGUURGVJNCH-UHFFFAOYSA-N

Molfile:  

 
     RDKit          2D

 25 28  0  0  0  0  0  0  0  0999 V2000
   -0.2849   -0.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2849   -0.9101    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4271   -1.3184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4271    0.3315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1392   -0.0851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1437   -0.9065    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4276   -2.1434    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9987   -1.3236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7137   -0.9122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9262   -1.1561    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.9190    0.1729    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4054   -0.4890    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1325    0.9697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5492    1.5533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7629    2.3475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5600    2.5611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1415    1.9818    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9328    1.1842    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9987   -2.1486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7132   -2.5611    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4277   -1.3255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1402   -0.9146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1415   -0.0894    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4319    0.3233    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7149   -0.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  1  4  1  0
  5  4  1  0
  3  6  1  0
  5  6  2  0
  3  7  2  0
  2  8  1  0
  8  9  1  0
  6 10  1  0
  5 11  1  0
 11 12  2  0
 12 10  1  0
 13 11  1  0
 14 13  2  0
 15 14  1  0
 16 15  2  0
 17 16  1  0
 13 18  1  0
 18 17  2  0
  8 19  1  0
 19 20  1  0
 21  9  2  0
 22 21  1  0
 23 22  2  0
 24 23  1  0
 25 24  2  0
  9 25  1  0
M  END

Alternative Forms

  1. Parent:

    ALA5274333

    ---

Associated Targets(Human)

DHPS Tchem Deoxyhypusine synthase (182 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 349.46Molecular Weight (Monoisotopic): 349.1249AlogP: 3.51#Rotatable Bonds: 4
Polar Surface Area: 59.22Molecular Species: BASEHBA: 4HBD: 1
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 8.73CX LogP: 2.64CX LogD: 1.30
Aromatic Rings: 3Heavy Atoms: 25QED Weighted: 0.78Np Likeness Score: -0.97

References

1. Tanaka Y, Kurasawa O, Yokota A, Klein MG, Saito B, Matsumoto S, Okaniwa M, Ambrus-Aikelin G, Uchiyama N, Morishita D, Kimura H, Imamura S..  (2020)  New Series of Potent Allosteric Inhibitors of Deoxyhypusine Synthase.,  11  (8.0): [PMID:34345355] [10.1021/acsmedchemlett.0c00331]

Source